| Company Name: |
Guangzhou Juntang Technology Co., Ltd Gold
|
| Tel: |
020-36607679 13502246435 |
| Email: |
sales@dmstandards.com |
| Products Intro: |
Product Name:2-Methyl-4-nitro-1-(oxiran-2-ylmethyl)-1H-imidazole
CAS:16773-51-6
Purity:＞95% Package:20mg，50mg，100mg，200mg
|
| Company Name: |
Dtchem Laboratories,（Gan Su）Co.,Ltd.
|
| Tel: |
18993961550 18993966060 |
| Email: |
sales@techbiochem.com |
| Products Intro: |
Product Name:Ornidazole Impurity 5
CAS:16773-51-6
Purity:95% HPLC Package:5KG;1KG;100G;50G;25G;10G
|
| Company Name: |
S.Z. PhyStandard Bio-Tech. Co., Ltd.
|
| Tel: |
0755-4000505016 13380397412 |
| Email: |
3001272453@qq.com |
| Products Intro: |
Product Name:Ornidazole Related Impurity 1
CAS:16773-51-6
Purity:98%HPLC Package:10mg;25mg;50mg;100mg
|
|
| | Ornidazole Impurity 5 Basic information | | Uses |
| Product Name: | Ornidazole Impurity 5 | | Synonyms: | 1H-Imidazole,2-methyl-4-nitro-1-(2-oxiranylmethyl)-;Ornidazole Impurity 33;2-?Oxiranylmethyl Ornidazole;2-Methyl-4-nitro-1-(oxiran-2-ylmethyl)-1H-imidazole (Ornidazole Impurity);Disodium phosphate levononidazole ester impurity 8;Morpholine Nitrazole Impurity VI;Phosphoric acid levononidazole ester disodium impurity 8 | | CAS: | 16773-51-6 | | MF: | C7H9N3O3 | | MW: | 183.16 | | EINECS: | | | Product Categories: | | | Mol File: | 16773-51-6.mol |  |
| | Ornidazole Impurity 5 Chemical Properties |
| InChI | InChI=1S/C7H9N3O3/c1-5-8-7(10(11)12)3-9(5)2-6-4-13-6/h3,6H,2,4H2,1H3 | | InChIKey | TUHYOMJIXVHZLL-UHFFFAOYSA-N | | SMILES | C1(C)N(CC2CO2)C=C([N+]([O-])=O)N=1 |
| | Ornidazole Impurity 5 Usage And Synthesis |
| Uses | 2-?Oxiranylmethyl Ornidazole is an impurity of Ornidazole (0688500), which maintains anti-infective properties. | | Uses | 2-Oxiranylmethyl Ornidazole is an impurity of Ornidazole (0688500), which maintains anti-infective properties. |
| | Ornidazole Impurity 5 Preparation Products And Raw materials |
|