|
|
| | Apixaban Impurity BMS-591329 Basic information |
| Product Name: | Apixaban Impurity BMS-591329 | | Synonyms: | Apixaban iMpurity 5;Apixaban Impurity 5, Apixaban impurity E (BMS-591329-01);Impurity of apixaban376;1H-Pyrazolo[3,4-c]pyridine-3-carboxamide, 1-(4-chlorophenyl)-4,5,6,7-tetrahydro-7-oxo-6-[4-(2-oxo-1-piperidinyl)phenyl]-;1-(4-chlorophenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[3,4-c]pyridine-3-carboxamide;Apixaban Impurity 42(BMS-591329);Apixaban-8;Apixaban impurity 5/1-(4-chlorophenyl)-7-oxo-6-(4-(2-oxopiperidin-1-yl)phenyl)-4,5,6,7-tetrahydro-1H-pyrazolo\[3,4-c]pyridine-3-carboxamide | | CAS: | 2029205-64-7 | | MF: | C24H22ClN5O3 | | MW: | 463.92 | | EINECS: | | | Product Categories: | | | Mol File: | 2029205-64-7.mol |  |
| | Apixaban Impurity BMS-591329 Chemical Properties |
| Boiling point | 765.5±60.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 14.85±0.20(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C24H22ClN5O3/c25-15-4-6-18(7-5-15)30-22-19(21(27-30)23(26)32)12-14-29(24(22)33)17-10-8-16(9-11-17)28-13-2-1-3-20(28)31/h4-11H,1-3,12-14H2,(H2,26,32) | | InChIKey | NFXFGADYJNOBGL-UHFFFAOYSA-N | | SMILES | C1(=O)N(C2=CC=C(N3CCCCC3=O)C=C2)CCC2C(C(N)=O)=NN(C3=CC=C(Cl)C=C3)C1=2 |
| | Apixaban Impurity BMS-591329 Usage And Synthesis |
| Uses | 1-(4-Chlorophenyl)-7-oxo-6-[4-(2-oxopiperidin-1-yl)phenyl]-4,5-dihydropyrazolo[3,4-c]pyridine-3-carboxamide is a reagent used in the preparation of SAR of apixaban derivatives as Fxa inhibitors. |
| | Apixaban Impurity BMS-591329 Preparation Products And Raw materials |
|