|
|
| | (3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid Basic information | | Uses |
| Product Name: | (3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid | | Synonyms: | (3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid;B-[3-(4-dibenzofuranyl)phenyl]-boronic acid;3-(Dibenzofuran-4-yl)phenylboronic acid;Boronic acid, B-[3-(4-dibenzofuranyl)phenyl]-;(3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid6 / 14 | | CAS: | 1271726-52-3 | | MF: | C18H13BO3 | | MW: | 288.11 | | EINECS: | | | Product Categories: | | | Mol File: | 1271726-52-3.mol | ![(3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid Structure](CAS/20180527/GIF/1271726-52-3.gif) |
| | (3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid Chemical Properties |
| Boiling point | 550.8±52.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 8.21±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C18H13BO3/c20-19(21)13-6-3-5-12(11-13)14-8-4-9-16-15-7-1-2-10-17(15)22-18(14)16/h1-11,20-21H | | InChIKey | NFFQEUGCDMASSS-UHFFFAOYSA-N | | SMILES | B(C1=CC=CC(C2=C3C(=CC=C2)C2=CC=CC=C2O3)=C1)(O)O |
| | (3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid Usage And Synthesis |
| Uses | (3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid is a heterocyclic derivative and can be used as a pharmaceutical intermediate for medical experimental research. | | Application | (3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid is mainly used as a pharmaceutical intermediate for medical experimental research. It can also be used as a coupling agent, etc. It can be used to prepare compounds such as 4-[4-(4-biphenyl)-2-(dibenzofuran-4-yl)-6-phenoxypyrimidin-5-yl]phenylboronic acid. |
| | (3-(dibenzo[b,d]furan-4-yl)phenyl)boronic acid Preparation Products And Raw materials |
|