|
|
| | 2-FLUORO-6-PICOLINE-5-BORONIC ACID Basic information |
| Product Name: | 2-FLUORO-6-PICOLINE-5-BORONIC ACID | | Synonyms: | 2-FLUORO-6-PICOLINE-5-BORONIC ACID;2-FLUORO-6-METHYLPYRIDINE-5-BORONIC ACID;(6-FLUORO-2-METHYLPYRIDIN-3-YL)BORONIC ACID;6-FLUORO-2-METHYLPYRIDINE-3-BORONIC ACID;(2-Fluoro-6-methylpyridin-5-yl)boronic acid;(6-FLUORO-2-METHYL-3-PYRIDYL)BORONIC ACID;3-Borono-6-fluoro-2-methylpyridine;Boronic acid,B-(6-fluoro-2-Methyl-3-pyridinyl) | | CAS: | 904326-91-6 | | MF: | C6H7BFNO2 | | MW: | 154.93 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 904326-91-6.mol |  |
| | 2-FLUORO-6-PICOLINE-5-BORONIC ACID Chemical Properties |
| Boiling point | 308.0±52.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 7.05±0.58(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H7BFNO2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-3,10-11H,1H3 | | InChIKey | FILPSSRLYOLUSF-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(F)N=C1C)(O)O |
| | 2-FLUORO-6-PICOLINE-5-BORONIC ACID Usage And Synthesis |
| | 2-FLUORO-6-PICOLINE-5-BORONIC ACID Preparation Products And Raw materials |
|