|
|
| | (-)-Diacetone-2-keto-L-gulonic acid monohydrate Basic information |
| Product Name: | (-)-Diacetone-2-keto-L-gulonic acid monohydrate | | Synonyms: | (-)-2,3:4,6-Di-O-isopropylidene-2-keto-L-gulonic Acid )-2,3:4,6-Di-O-isopropylidene-2-keto-L-gulonic acid monohydrate;(-)-2,3:4,6-DI-O-ISOPROPYLIDENE-2-KETO-L-GULONIC ACID MONOHYDRATE;(-)-2,3:4,6-DI-O-ISOPROPYLIDENE-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID MONOHYDRATE;2,3:4,6-DI-O-ISOPROPYLIDENE-ALPHA-L-XYLO-2-HEXULOFURANOSONIC ACID MONOHYDRATE;(-)-2,3:4,6-Di-O-isoproyplidene-2-keto-L-gulonic acid monohydrate;DIKEGULAC MONOHYDRATE;isopropylidene-2-keto-L-gulonic Acid | | CAS: | 68539-16-2 | | MF: | C12H20O8 | | MW: | 292.28 | | EINECS: | | | Product Categories: | Biochemistry;Gulose;O-Substituted Sugars;Plant Growth Regulators;Plant Growth Trgulators (Others);Sugar Acids;Sugars | | Mol File: | 68539-16-2.mol |  |
| | (-)-Diacetone-2-keto-L-gulonic acid monohydrate Chemical Properties |
| Melting point | 88-90 °C(lit.) | | alpha | -20 º (c=2 in methanol) | | refractive index | -20 ° (C=2, MeOH) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Light yellow | | Optical Rotation | [α]21/D 20°, c = 2 in methanol | | Merck | 14,3199 | | InChI | InChI=1/C12H18O7.H2O/c1-10(2)15-5-6-7(17-10)8-12(16-6,9(13)14)19-11(3,4)18-8;/h6-8H,5H2,1-4H3,(H,13,14);1H2/t6-,7+,8-,12+;/s3 | | InChIKey | ZFQRGFMVXLSLKZ-ZYRLPJSWNA-N | | SMILES | C([C@]12OC(C)(C)O[C@@]1([H])[C@]1([H])OC(C)(C)OC[C@]1([H])O2)(=O)O.O |&1:1,7,9,17,r| | | CAS DataBase Reference | 68539-16-2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2940000080 | | Storage Class | 11 - Combustible Solids |
| | (-)-Diacetone-2-keto-L-gulonic acid monohydrate Usage And Synthesis |
| | (-)-Diacetone-2-keto-L-gulonic acid monohydrate Preparation Products And Raw materials |
|