| Company Name: |
SYNTHENTA PVT LTD
|
| Tel: |
+91-7416102217 +91-7416102217 |
| Email: |
gvpratapreddy@synthenta.com |
| Products Intro: |
Product Name:Deuterated Methyl methacrylate-d8 CAS:35233-69-3 Purity:97-99% Package:1kg,5kg, 10kg, 25kg & 50kg
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Methyl-d3 methacrylate-d5, packaged in ampoules, stabilized, 99 atom% D, for NMR CAS:35233-69-3 Package:1GR
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Methyl Methacrylate-d8 CAS:35233-69-3 Remarks:CS-C-02529
|
|
| | METHYL METHACRYLATE-D8 Basic information |
| Product Name: | METHYL METHACRYLATE-D8 | | Synonyms: | METHYL-D3 METHACRYLATE-D5;METHYL METHACRYLATE-D8;(2H3)methyl (3,3,alpha,alpha,alpha-2H5)methacrylate;METHYL-D3 METHACRYLATE-D5, 99 ATOM % D;2-Propenoic-3,3-d2 acid, 2-(methyl-d3)-, methyl-d3 ester;Methyl methacrylate-D8 99.50 Atom % D;3-d2acid,2-(methyl-d3)-2-propenoic-methyl-d3ester;METHYL-D3 METHACRYLATE-D5, STABILIZED, 99.5 ATOM% D, FOR NMR | | CAS: | 35233-69-3 | | MF: | C5D8O2 | | MW: | 108.17 | | EINECS: | 252-449-9 | | Product Categories: | | | Mol File: | 35233-69-3.mol |  |
| | METHYL METHACRYLATE-D8 Chemical Properties |
| Melting point | -48 °C (lit.) | | Boiling point | 100 °C (lit.) | | density | 1.011 g/mL at 25 °C | | refractive index | n20/D 1.413(lit.) | | Fp | 50 °F | | storage temp. | 2-8°C | | Stability: | Stable, but may polymerize upon exposure to light. Highly flammable - store cold. Hygroscopic. Incompatible with oxidizing agents, bases, amines, peroxides, acids, reducing agents, halogens, polymerization initiators. | | InChI | 1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3/i1D2,2D3,3D3 | | InChIKey | VVQNEPGJFQJSBK-MGGKGRBPSA-N | | SMILES | [2H]\C([2H])=C(\C(=O)OC([2H])([2H])[2H])C([2H])([2H])[2H] | | CAS DataBase Reference | 35233-69-3 | | EPA Substance Registry System | Perdeutero(methyl methacrylate) (35233-69-3) | | CAS Number Unlabeled | 80-62-6 |
| Hazard Codes | F,Xi | | Risk Statements | 11-37/38-43 | | Safety Statements | 24-37-46 | | RIDADR | UN 1247 3/PG 2 | | WGK Germany | 1 | | RTECS | OZ5075000 | | TSCA | TSCA listed | | HS Code | 28459010 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 Skin Irrit. 2 Skin Sens. 1B STOT SE 3 |
| | METHYL METHACRYLATE-D8 Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | Methyl Methacrylate-d8 (CAS# 35233-69-3) is a useful isotopically labeled research compound. |
| | METHYL METHACRYLATE-D8 Preparation Products And Raw materials |
|