- Chlorfenazole
-
- $1.00
-
2020-01-03
- CAS:3574-96-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KGS
|
| | Chlorfenazole Basic information |
| | Chlorfenazole Chemical Properties |
| Melting point | 234-238 °C(lit.) | | Boiling point | 427.9±47.0 °C(Predicted) | | density | 1.326±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | Crystalline Powder | | pka | 11.10±0.10(Predicted) | | color | White | | BRN | 173013 | | InChI | 1S/C13H9ClN2/c14-10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)16-13/h1-8H,(H,15,16) | | InChIKey | OILIYWFQRJOPAI-UHFFFAOYSA-N | | SMILES | Clc1ccccc1-c2nc3ccccc3[nH]2 | | CAS DataBase Reference | 3574-96-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 37/39 | | WGK Germany | 3 | | RTECS | DD6963500 | | HS Code | 2933.99.8290 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | Chlorfenazole Usage And Synthesis |
| Chemical Properties | Light yellow solid. | | Uses | Chlorfenazole, also known as 2-(2-Chlorophenyl)-1H-benzimidazole, is a biologically active compound that is commonly used in agriculture. It belongs to the benzimidazole derivative family and has the potential to display anti-parasitic, anti-fungal, or anti-inflammatory properties. | | Safety Profile | A poison by ingestion.
When heated to decomposition it emits
toxic vapors of NOx and Cl-. |
| | Chlorfenazole Preparation Products And Raw materials |
|