- Fmoc-N-Me-D-Leu-OH
-
-
2026-07-24
- CAS:103478-63-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Fmoc-N-Me-D-Leu-OH
-
- $1.00
-
2020-01-06
- CAS:103478-63-3
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | Fmoc-N-methyl-D-leucine Basic information |
| Product Name: | Fmoc-N-methyl-D-leucine | | Synonyms: | N-ALPHA-FMOC-N-ALPHA-METHYL-D-LEUCINE;N-ALPHA-(9-FLUORENYLMETHYLOXYCARBONYL)-N-ALPHA-METHYL-D-LEUCINE;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-N-ALPHA-METHYL-D-LEUCINE;FMOC-N-METHYL-D-LEUCINE 98+%;FMOC-D-MELEU-OH;FMOC-N-METHYL-D-LEUCINE;FMOC-N-ALPHA-METHYL-D-LEUCINE;REF DUPL: Fmoc-D-N-Me-Leu-OH | | CAS: | 103478-63-3 | | MF: | C22H25NO4 | | MW: | 367.44 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 103478-63-3.mol |  |
| | Fmoc-N-methyl-D-leucine Chemical Properties |
| Melting point | 108-116 °C | | Boiling point | 537.3±29.0 °C(Predicted) | | density | 1.194±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in clear solution (0.3 gram in 2 ml DMF). | | form | Powder | | pka | 3.93±0.21(Predicted) | | color | Off-white | | BRN | 7350417 | | Major Application | peptide synthesis | | InChI | 1S/C22H25NO4/c1-14(2)12-20(21(24)25)23(3)22(26)27-13-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,14,19-20H,12-13H2,1-3H3,(H,24,25)/t20-/m1/s1 | | InChIKey | BUJQSIPFDWLNDC-HXUWFJFHSA-N | | SMILES | CC(C)C[C@@H](N(C)C(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O | | CAS DataBase Reference | 103478-63-3(CAS DataBase Reference) |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-N-methyl-D-leucine Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Tripeptides were prepared by means of coupling of N-Fmoc-N-methyl-D-leucine. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-N-methyl-D-leucine Preparation Products And Raw materials |
|