|
|
| | FEXOFENADINE, METHYL ESTER Basic information |
| | FEXOFENADINE, METHYL ESTER Chemical Properties |
| Melting point | 157-158 °C | | Boiling point | 659.3±55.0 °C(Predicted) | | density | 1.137±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.32±0.29(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical small molecule | | InChIKey | GOUQSHOAAGQXNJ-UHFFFAOYSA-N | | SMILES | N2(CCC(CC2)C(O)(c4ccccc4)c3ccccc3)CCCC(O)c1ccc(cc1)C(C)(C)C(=O)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | FEXOFENADINE, METHYL ESTER Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | A novel intermediate of Fexofenadine (F322470). |
| | FEXOFENADINE, METHYL ESTER Preparation Products And Raw materials |
|