- Ala-Ala-OH
-
-
2026-07-24
- CAS:1948-31-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- L-Alanyl-L-alanine
-
- $70.00
-
2026-07-06
- CAS:1948-31-8
- Min. Order: 1KG
- Purity: 0.98
- Supply Ability: 20 tons
- L-Alanyl-L-alanine
-
-
2025-04-04
- CAS:1948-31-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1Ton
|
| | L-Alanyl-L-alanine Basic information |
| Product Name: | L-Alanyl-L-alanine | | Synonyms: | Ala-Ala-OH·HCl≥ 98% (HPLC);L-Alanyl-L-alanine hydrochloride;(2S)-2-(alanylamino)propionic acid;(2S)-2-[[(2S)-2-amino-1-oxopropyl]amino]propanoic acid;(2S)-2-[[(2S)-2-ammonio-1-oxopropyl]amino]propanoate;(2S)-2-[[(2S)-2-ammoniopropanoyl]amino]propionate;(2S)-2-[[(2S)-2-azaniumylpropanoyl]amino]propanoate;N-L-alanyl-L-alanine | | CAS: | 1948-31-8 | | MF: | C6H12N2O3 | | MW: | 160.17 | | EINECS: | 217-751-7 | | Product Categories: | 99%;Amino Acid Derivatives | | Mol File: | 1948-31-8.mol |  |
| | L-Alanyl-L-alanine Chemical Properties |
| Melting point | 280-285 °C(lit.) | | Boiling point | 286.06°C (rough estimate) | | density | 1.208 | | refractive index | 1.4500 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | H2O: 0.1 g/mL, clear | | pka | 3.16±0.10(Predicted) | | form | Solid | | color | white | | BRN | 1724813 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11)/t3-,4-/m0/s1 | | InChIKey | DEFJQIDDEAULHB-IMJSIDKUSA-N | | SMILES | C[C@H](N)C(=O)N[C@@H](C)C(O)=O | | CAS DataBase Reference | 1948-31-8(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2924190002 | | Storage Class | 11 - Combustible Solids |
| | L-Alanyl-L-alanine Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | L-Alanyl-L-alanine is usually used as a model dipeptide in physicochemical studies of processes such as the effects of pH (protonation) on conformation. | | Definition | ChEBI: A dipeptide consisting of two L-alanine units joined by a peptide linkage. | | Biological Activity | L-Alanyl-L-alanine is used as a model dipeptide in physicochemical studies of processes such as the effects of pH (protonation) on conformation. |
| | L-Alanyl-L-alanine Preparation Products And Raw materials |
|