- Peramivir Enantiomer
-
-
2025-12-16
- CAS:229615-12-7
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 100000000
|
| | Peramivir Impurity 4 Basic information |
| Product Name: | Peramivir Impurity 4 | | Synonyms: | Peramivir impurities454;(1S,2S,3R,4R)-3-((S)-1-acetamido-2-ethylbutyl)-2-acetoxy-4-guanidinocyclopentane-1-carboxylic acid;PeramivirPeramivir Enantiomer;(+)-ent-Peramivir;Cyclopentanecarboxylic acid, 3-[(1R)-1-(acetylamino)-2-ethylbutyl]-4-[(aminoiminomethyl)amino]-2-hydroxy-, (1R,2R,3S,4S)-;Peramivir Impurity 4;Paramivir impurity 1;Peramivir Impurity 32 Formate salt | | CAS: | 229615-12-7 | | MF: | C15H28N4O4 | | MW: | 328.41 | | EINECS: | | | Product Categories: | | | Mol File: | 229615-12-7.mol |  |
| | Peramivir Impurity 4 Chemical Properties |
| density | 1.39±0.1 g/cm3(Predicted) | | pka | 4.08±0.70(Predicted) | | InChIKey | XRQDFNLINLXZLB-SJHCENCUSA-N | | SMILES | [C@@H]1(C(O)=O)C[C@H](NC(N)=N)[C@@H]([C@H](NC(C)=O)C(CC)CC)[C@H]1O |
| | Peramivir Impurity 4 Usage And Synthesis |
| Uses | (+)-ent-Peramivir is the enantiomer of Peramivir (P285500) which is an antiviral drug used for treatment of influenza. |
| | Peramivir Impurity 4 Preparation Products And Raw materials |
|