| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(4S,5S)-2,2-DiMethyl-α,α,α′,α′-tetra(2-naphthyl)dioxolane-4,5-diMethanol
CAS:137365-16-3
Purity:98% Package:1G,1G
|
| Company Name: |
Tianjin Derchemist Science & Technology Co., Ltd.
|
| Tel: |
22-58627059 13920586291 |
| Email: |
zdcomcon@126.com |
| Products Intro: |
Product Name:[(4S,5S)-5-[hydroxy(dinaphthalen-2-yl)Methyl]-2,2-diMethyl-1,3-dioxolan-4-yl]-dinaphthalen-2-ylMethanol
CAS:137365-16-3
Purity:98% Package:500g/1kg/10kg/20kg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(4S-trans)-2,2-Dimethyl-alpha,alpha,alpha',alpha'-tetra(2-naphthyl)-1,3-dioxolane-4,5-dimethanol
CAS:137365-16-3
Purity:98% Package:1G Remarks:393762-1G
|
| Company Name: |
Shanghai Chiral bio-compound co., Ltd.
|
| Tel: |
021-5068 3667/17749785980/1029026415; 17749785980 |
| Email: |
1029026415@qq.com |
| Products Intro: |
Product Name:(4S,5S)-2,2-dimethyl-α4,α4,α5,α5-tetra-2-naphthalenyl-1,3-Dioxolane-4,5-dimethanol
CAS:137365-16-3
Purity:97% Package:100mg,1g,100g,1kg
|
|
| | (+)-2,3-O-ISOPROPYLIDENE-1,1,4,4-TETRA(2-NAPHTHYL)-D-THREITOL Basic information |
| Product Name: | (+)-2,3-O-ISOPROPYLIDENE-1,1,4,4-TETRA(2-NAPHTHYL)-D-THREITOL | | Synonyms: | (4S,5S)-2,2-dimethyl-α4,α4,α5,α5-tetra-2-naphthalenyl-1,3-Dioxolane-4,5-dimethanol;(+)-2,3-O-ISOPROPYLIDENE-1,1,4,4-TETRA(2-NAPHTHYL)-D-THREITOL;(4S-TRANS)-2,2-DIMETHYL-ALPHA,ALPHA,ALPHA',ALPHA'-TETRA(2-NAPHTHYL)-1,3-DIOXOLANE-4,5-DIMETHANOL;(4S,5S)-2,2-DIMETHYL-ALPHA,ALPHA,ALPHA',ALPHA'-TETRA(2-NAPHTHYL)DIOXOLANE-4,5-DIMETHANOL;(+)-DINOL;(+)-2,3-O-isopropylidene-1,1,4,4-tetra (2-naph.)-D-threitol;(4S-trans)-2,2-di-me-A,A,A,A-tetra-2-nap -dioxo;(4S-TRANS)-2,2-DI-ME-A,A,A',A'-TETRA-2-N AP -DIOXOLAN-DIMETHANOL, 98%(99% EE/HPLC | | CAS: | 137365-16-3 | | MF: | C47H38O4 | | MW: | 666.8 | | EINECS: | | | Product Categories: | | | Mol File: | 137365-16-3.mol |  |
| | (+)-2,3-O-ISOPROPYLIDENE-1,1,4,4-TETRA(2-NAPHTHYL)-D-THREITOL Chemical Properties |
| Melting point | 214-216 °C(lit.) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.14±0.29(Predicted) | | Optical Rotation | [α]20/D +116°, c = 1 in ethyl acetate | | InChIKey | QWADMRIAKWGVBF-CXNSMIOJSA-N | | SMILES | CC1(C)O[C@@H]([C@H](O1)C(O)(c2ccc3ccccc3c2)c4ccc5ccccc5c4)C(O)(c6ccc7ccccc7c6)c8ccc9ccccc9c8 |
| WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | (+)-2,3-O-ISOPROPYLIDENE-1,1,4,4-TETRA(2-NAPHTHYL)-D-THREITOL Usage And Synthesis |
| Uses | Reagent for the highly enantioselective addition of primary alkyl Grignards to ketones. Chiral auxiliary used for the asymmetric addition of nucleophiles to carbonyls. |
| | (+)-2,3-O-ISOPROPYLIDENE-1,1,4,4-TETRA(2-NAPHTHYL)-D-THREITOL Preparation Products And Raw materials |
|