PHE-GLY-GLY manufacturers
- PHE-GLY-GLY
-
- $3.00
-
2019-07-12
- CAS:23576-42-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | PHE-GLY-GLY Basic information |
| | PHE-GLY-GLY Chemical Properties |
| Melting point | 235-236 °C (decomp) | | Boiling point | 667.3±55.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | form | Solid | | pka | 3.30±0.10(Predicted) | | color | White to off-white | | Major Application | cell analysis | | InChI | 1S/C13H17N3O4/c14-10(6-9-4-2-1-3-5-9)13(20)16-7-11(17)15-8-12(18)19/h1-5,10H,6-8,14H2,(H,15,17)(H,16,20)(H,18,19)/t10-/m0/s1 | | InChIKey | NAXPHWZXEXNDIW-JTQLQIEISA-N | | SMILES | OC(CNC(CNC([C@@H](N)CC1=CC=CC=C1)=O)=O)=O | | CAS DataBase Reference | 23576-42-3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | PHE-GLY-GLY Usage And Synthesis |
| Uses | cell analysis | | Definition | ChEBI: A tripeptide composed of one L-phenylalanine and two glycine residues joined in sequence. |
| | PHE-GLY-GLY Preparation Products And Raw materials |
|