N6,N6-DIMETHYLADENOSINE manufacturers
|
| | N6,N6-DIMETHYLADENOSINE Basic information |
| | N6,N6-DIMETHYLADENOSINE Chemical Properties |
| Melting point | 184-185°C | | Boiling point | 607.3±65.0 °C(Predicted) | | density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly, Heated), DMSO, Methanol (Sparingly) | | form | Solid | | pka | 13.11±0.70(Predicted) | | color | White to Off-White | | PH | 4.5 | | λmax | 268 (pH 1);275 (pH 7) | | InChI | InChI=1S/C12H17N5O4/c1-16(2)10-7-11(14-4-13-10)17(5-15-7)12-9(20)8(19)6(3-18)21-12/h4-6,8-9,12,18-20H,3H2,1-2H3/t6-,8-,9-,12-/m1/s1 | | InChIKey | WVGPGNPCZPYCLK-WOUKDFQISA-N | | SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)N(C)C)N=C2)[C@H](O)[C@@H]1O | | CAS DataBase Reference | 2620-62-4(CAS DataBase Reference) |
| | N6,N6-DIMETHYLADENOSINE Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | 6-Dimethylaminopurine-9-riboside (cas# 2620-62-4) is a compound useful in organic synthesis. | | Definition | ChEBI: A methyladenosine compound with two methyl groups attached to N6 of the adenine nucleobase. |
| | N6,N6-DIMETHYLADENOSINE Preparation Products And Raw materials |
|