| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Disperse Orange 3 acrylamide CAS:150375-01-2 Purity:Disperse Orange 3 acrylamide Package:100MG Remarks:595969-100MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Disperse Orange 3 acrylamide CAS:150375-01-2 Purity:NULL Package:100mg Remarks:NULL
|
| Company Name: |
Okeanos Tech Co,. Ltd.
|
| Tel: |
01062651721 18610486005 |
| Email: |
info@okeanos.com.cn |
| Products Intro: |
Product Name:Disperse Orange 3 acrylamide CAS:150375-01-2 Purity:97% HPLC Package:1g;5g;10g;25g;
|
DISPERSE ORANGE 3 ACRYLAMIDE 90 manufacturers
|
| | DISPERSE ORANGE 3 ACRYLAMIDE 90 Basic information |
| | DISPERSE ORANGE 3 ACRYLAMIDE 90 Chemical Properties |
| Melting point | 206.5 °C (dec.)(lit.) | | storage temp. | 2-8°C | | form | solid | | λmax | 222 nm (2nd) 222 nm (2nd) 375 nm 375 nm | | InChI | 1S/C15H12N4O3/c1-2-15(20)16-11-3-5-12(6-4-11)17-18-13-7-9-14(10-8-13)19(21)22/h2-10H,1H2,(H,16,20)/b18-17+ | | InChIKey | UFJASOUPUMZANE-ISLYRVAYSA-N | | SMILES | [O-][N+](=O)c1ccc(cc1)\N=N\c2ccc(NC(=O)C=C)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | DISPERSE ORANGE 3 ACRYLAMIDE 90 Usage And Synthesis |
| | DISPERSE ORANGE 3 ACRYLAMIDE 90 Preparation Products And Raw materials |
|