|
|
| | FMOC-HOMOSER(TRT)-OH Basic information |
| Product Name: | FMOC-HOMOSER(TRT)-OH | | Synonyms: | nα-fmoc-o-trityl-l-homoserine;(S)-2-(((9H-fluoren-9-yl)methoxy)carbonylamino)-4-(trityloxy)butanoic acid;N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-O-(triphenylmethyl)-L-homoserine;FMoc-Hse(Trt)-OH FMoc-O-trityl-L-hoMoserine;FMOC-HOSER(TRT)-OH ;FMOC-O-TRITYL-L-HOMOSERINE;Fmoc-Homoser(Trt)-OH >=98.0% (HPLC);Fmoc-L-HomoSer(Trt)-OH;Fmoc-O-trityl-L-homoserine≥ 99.8% (HPLC, Chiral purity) | | CAS: | 111061-55-3 | | MF: | C38H33NO5 | | MW: | 583.67 | | EINECS: | | | Product Categories: | amino acids | | Mol File: | 111061-55-3.mol |  |
| | FMOC-HOMOSER(TRT)-OH Chemical Properties |
| Melting point | 108-110 °C | | Boiling point | 767.5±60.0 °C(Predicted) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 3.69±0.10(Predicted) | | color | White | | Major Application | peptide synthesis | | InChIKey | QUTREFXHXPNEJN-DHUJRADRSA-N | | SMILES | C(O)(=O)[C@H](CCOC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| WGK Germany | 3 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | FMOC-HOMOSER(TRT)-OH Usage And Synthesis |
| Chemical Properties | White to off-white crystals | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-HOMOSER(TRT)-OH Preparation Products And Raw materials |
|