|
|
| | 2-ETHYL-6-METHYL-2-CHLOROACETANILIDE Basic information |
| Product Name: | 2-ETHYL-6-METHYL-2-CHLOROACETANILIDE | | Synonyms: | 2-CHLORO-N-(2-ETHYL-6-METHYLPHENYL)ACETAMIDE;2-CHLORO-(N-2-METHYL-6-ETHYL PHENYL)ACETAMIDE;2-chloro-N-(2-ethyl-6-methyl-phenyl)ethanamide;N-(Chloroacetyl)-2-ethyl-6-methylaniline;CGA 13656;Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)-;SKL909;Verapamil Impurity 40 | | CAS: | 32428-71-0 | | MF: | C11H14ClNO | | MW: | 211.69 | | EINECS: | | | Product Categories: | | | Mol File: | 32428-71-0.mol |  |
| | 2-ETHYL-6-METHYL-2-CHLOROACETANILIDE Chemical Properties |
| Melting point | 120-121 °C(Solv: ethanol, 50% (64-17-5)) | | Boiling point | 343.1±37.0 °C(Predicted) | | density | 1.156±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 12.91±0.70(Predicted) | | color | Off-White to Pale Red | | InChI | InChI=1S/C11H14ClNO/c1-3-9-6-4-5-8(2)11(9)13-10(14)7-12/h4-6H,3,7H2,1-2H3,(H,13,14) | | InChIKey | SMINYPCTNJDYGK-UHFFFAOYSA-N | | SMILES | C(NC1=C(C)C=CC=C1CC)(=O)CCl | | CAS DataBase Reference | 32428-71-0 | | EPA Substance Registry System | Acetamide, 2-chloro-N-(2-ethyl-6-methylphenyl)- (32428-71-0) |
| | 2-ETHYL-6-METHYL-2-CHLOROACETANILIDE Usage And Synthesis |
| Chemical Properties | This product is white crystal, insoluble in water at room temperature, slightly soluble in ethanol, acetone and other solvents. | | Uses | 2-Ethyl-6-methyl-2-chloroacetanilide is an intermediate of the herbicides acetochlor, metolachlor and metolachlor. | | Definition | ChEBI: N-(2-ethyl-6-methylphenyl)-2-chloroacetamide is an aromatic amide obtained by formal condensation of the carboxy group of chloroacetic acid with the amnio group of 2-ethyl-6-methylaniline. It is an aromatic amide and an organochlorine compound. It is functionally related to a chloroacetic acid. | | Synthesis | 2-Ethyl-6-methyl-2-chloroacetanilide is obtained by mixing xylene and chloroacetic acid and adding 2-methyl-6-ethylaniline. |
| | 2-ETHYL-6-METHYL-2-CHLOROACETANILIDE Preparation Products And Raw materials |
|