|
|
| | 2-Bromo-4-fluoronitrobenzene Basic information |
| Product Name: | 2-Bromo-4-fluoronitrobenzene | | Synonyms: | 1-Bromo-5-fluoro-2-nitrobenzene;2-Bromo-4-fluoronitrobenzene;2-BroMo-4-fluoronitrobenzene, 97+%;2-Bromo-4-fluoro-1-nitrobenzene >2-Bromo-4-fluoronitrobenzene,>98%;Benzene, 2-bromo-4-fluoro-1-nitro-;2-Bromo-4-fluoronitrobenzene ISO 9001:2015 REACH;2-bromine-4-fluorine-1-Nitrobenzene | | CAS: | 700-36-7 | | MF: | C6H3BrFNO2 | | MW: | 220 | | EINECS: | 670-950-4 | | Product Categories: | | | Mol File: | 700-36-7.mol |  |
| | 2-Bromo-4-fluoronitrobenzene Chemical Properties |
| Melting point | 44 °C | | Boiling point | 70-75 °C(Press: 0.4 Torr) | | density | 1.808±0.06 g/cm3(Predicted) | | refractive index | 1.57 | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Solid | | color | Pale yellow to green | | InChI | InChI=1S/C6H3BrFNO2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H | | InChIKey | VGYVBEJDXIPSDL-UHFFFAOYSA-N | | SMILES | C1([N+]([O-])=O)=CC=C(F)C=C1Br | | CAS DataBase Reference | 700-36-7 |
| Safety Statements | 24/25 | | HS Code | 29049090 |
| | 2-Bromo-4-fluoronitrobenzene Usage And Synthesis |
| Chemical Properties | Yellow to pale green powder | | Uses | 2-Bromo-4-fluoro-1-nitrobenzene can be used as a valuable building block, mainly for the preparation of Benzimidazoles. | | Synthesis | General procedure for the synthesis of 1-bromo-5-fluoro-2-nitrobenzene from 4-fluoroaniline: N-bromosuccinimide (34 g, 180 mmol) was dissolved in dichloromethane (60 mL) at 0 °C and slowly added dropwise to a solution of 4-fluoroaniline (20 g, 180 mmol) in dichloromethane (100 mL). The reaction mixture was stirred at room temperature overnight. Upon completion of the reaction, it was washed sequentially with saturated sodium sulfite solution, saturated sodium bicarbonate solution and brine, and then concentrated to give 1-bromo-5-fluoro-2-nitrobenzene (34 g, 154.5 mmol, 100% yield). The 1H NMR (400 MHz, CDCl3) data of the product were as follows: δ 7.12-7.21 (m, 1H), 7.47 (dd, J = 7.60, 2.40 Hz, 1H), (dd, J = 9.60, 6.40 Hz, 1H). | | References | [1] Patent: US2008/300242, 2008, A1. Location in patent: Page/Page column 62 |
| | 2-Bromo-4-fluoronitrobenzene Preparation Products And Raw materials |
|