N-Boc-3-Ethylpiperazine manufacturers
- N-Boc-3-Ethylpiperazine
-
- $6.68
-
2020-01-09
- CAS: 438049-35-5
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | N-Boc-3-Ethylpiperazine Basic information |
| | N-Boc-3-Ethylpiperazine Chemical Properties |
| Boiling point | 286.7±15.0 °C(Predicted) | | density | 0.981±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 8.52±0.40(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | -0.0975°(C=1g/100ml CHCL3) | | InChI | InChI=1S/C11H22N2O2/c1-5-9-8-13(7-6-12-9)10(14)15-11(2,3)4/h9,12H,5-8H2,1-4H3 | | InChIKey | DXJOJUNLMJMJSN-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNC(CC)C1 | | CAS DataBase Reference | 438049-35-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | HS Code | 2933599590 |
| | N-Boc-3-Ethylpiperazine Usage And Synthesis |
| | N-Boc-3-Ethylpiperazine Preparation Products And Raw materials |
|