|
|
| | 4-Hydroxycinnamic acid Basic information |
| Product Name: | 4-Hydroxycinnamic acid | | Synonyms: | 4-Hydroxycinnamic Acid (CIS-);(Z)-3-(4-Hydroxyphenyl)propenoic acid;4-Hydroxy-cis-cinnamic acid;3-(4-Hydroxyphenyl)prop-2-enoic acid;(2Z)-3-(4-Hydroxyphenyl)-2-propenoic Acid;(Z)-3-(4-hydroxyphenyl)-2-propenoic Acid;(Z)-p-CouMaric Acid;(Z)-p-hydroxycinnaMic Acid | | CAS: | 4501-31-9 | | MF: | C9H8O3 | | MW: | 164.16 | | EINECS: | 224-813-7 | | Product Categories: | Aromatics;Intermediates | | Mol File: | 4501-31-9.mol |  |
| | 4-Hydroxycinnamic acid Chemical Properties |
| Melting point | 130-131 °C | | Boiling point | 346.1±17.0 °C(Predicted) | | density | 1.329±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer | | solubility | Acetone (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.59±0.10(Predicted) | | color | White to Off-White | | Stability: | Light Sensitive | | InChI | InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3- | | InChIKey | NGSWKAQJJWESNS-UTCJRWHESA-N | | SMILES | C(O)(=O)/C=C\C1=CC=C(O)C=C1 | | LogP | 1.876 (est) | | NIST Chemistry Reference | 2-Propenoic acid, 3-(4-hydroxyphenyl)-, (Z)-(4501-31-9) |
| | 4-Hydroxycinnamic acid Usage And Synthesis |
| Uses | An antioxidative active compound isolated from the EtOAc layer of MeOH extracts of kochujang, Korean fermented red pepper paste. Photoisomerization of ionic liquid ammonium cinnamates. Cinnamic acids upon irradiation in solution undergo geometric isomerization while dimerizing to different dimers in the crystalline state. | | Definition | ChEBI: The cis-form of 4-coumaric acid. |
| | 4-Hydroxycinnamic acid Preparation Products And Raw materials |
|