|
|
| | 4-(1-PYRROLIDINO)BENZALDEHYDE Basic information |
| | 4-(1-PYRROLIDINO)BENZALDEHYDE Chemical Properties |
| Melting point | 85 °C | | Boiling point | 329.4±25.0 °C(Predicted) | | density | 1.125±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 5.68±0.20(Predicted) | | color | Light yellow to Brown to Dark green | | Sensitive | Air Sensitive | | BRN | 135279 | | InChI | 1S/C11H13NO/c13-9-10-3-5-11(6-4-10)12-7-1-2-8-12/h3-6,9H,1-2,7-8H2 | | InChIKey | DATXHLPRESKQJK-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(cc1)N2CCCC2 | | CAS DataBase Reference | 51980-54-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 4-(1-PYRROLIDINO)BENZALDEHYDE Usage And Synthesis |
| | 4-(1-PYRROLIDINO)BENZALDEHYDE Preparation Products And Raw materials |
|