|
|
| Product Name: | Dicentrin | | Synonyms: | DICENTRINE95%;(7aS)-6,7,7a,8-Tetrahydro-10,11-dimethoxy-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline;1,2-Methylenedioxy-9,10-dimethoxyaporphine;5H-Benzo[G]-1,3-benzodioxolo[6,5,4-de]quinoline, 6,7,7A,8-tetrahydro-10,11-dimethoxy-7-methyl-, (S)-;6A.alpha.-Aporphine, 9,10-dimethoxy-1,2-(methylenedioxy)-;9,10-Dimethoxy-1,2-(methylenedioxy)aporphine;Nsc406035;o,N-Dimethyllitseferine | | CAS: | 517-66-8 | | MF: | C20H21NO4 | | MW: | 339.39 | | EINECS: | | | Product Categories: | | | Mol File: | 517-66-8.mol |  |
| | Dicentrin Chemical Properties |
| Melting point | 177-178℃ | | Boiling point | 481℃ | | density | 1.266 | | refractive index | 1.6250 (estimate) | | Fp | 143℃ | | storage temp. | 4°C, protect from light | | solubility | Soluble in DMSO | | pka | 6.65±0.20(Predicted) | | form | Solid | | color | Off-white to light brown | | InChI | InChI=1S/C20H21NO4/c1-21-5-4-11-7-17-20(25-10-24-17)19-13-9-16(23-3)15(22-2)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m0/s1 | | InChIKey | YJWBWQWUHVXPNC-AWEZNQCLSA-N | | SMILES | N1(C)[C@]2([H])C3=C(C4=C(C=C3CC1)OCO4)C1=CC(OC)=C(OC)C=C1C2 |
| | Dicentrin Usage And Synthesis |
| Description | D-Dicentrine is an aporphinic alkaloid found in several plant species, mainly from family Lauraceae, including Lindera megaphylla. D-Dicentrine shows antinociceptive activity in a mouse model of pain. It probably acts via a TRPA1-dependent mechanism. D-Dicentrine is an alpha 1-adrenoceptor antagonist effective against human hyperplastic prostates.
| | Anti-cancer Activity | D-Dicentrine, a naturally occurring aporphine type isoquinoline alkaloid, isolated from the root of Lindera megaphylla Hemsl. (Lauraceae), was evaluated for its potential anti-cancer activity. Huang RL etc. found d-dicentrine significantly inhibited the growth of human hepatoma cell line HuH-7 by delaying its doubling time in tissue culture. An in vitro colony forming assay showed that d-dicentrine decreased the colony formation efficiency in both hepatoma cell lines, HuH-7 and MS-G2, used in our study.
| | Uses | d-Dicentrine is a natural aporphine alkaloid extracted from the root of L. megaphylla which displays antitumor effects through inhibition of topoisomerase II. | | Definition | ChEBI: Dicentrine is an aporphine alkaloid. | | IC 50 | α adrenergic receptor |
| | Dicentrin Preparation Products And Raw materials |
|