Norcamphor, dehydro- manufacturers
- 5-Norbornen-2-one
-
- $178.00
-
2026-07-24
- CAS:694-98-4
- Min. Order: 5g
- Purity: 0.97
- Supply Ability: 25kg
|
| | Norcamphor, dehydro- Basic information |
| Product Name: | Norcamphor, dehydro- | | Synonyms: | Norcamphor, dehydro-;norborn-5-en-2-one;5-Norbornen-2-one;(+/-)-bicyclo[2.2.1]hept-5-en-2-one;bicyclo[2.2.1]hept-5-en-2-one - [B87263];biscyclo[2.2.1]heptyl-5-ene-2-one;Bicyclo[2.2.1]hept-5-en-2-one | | CAS: | 694-98-4 | | MF: | C7H8O | | MW: | 108.14 | | EINECS: | | | Product Categories: | | | Mol File: | 694-98-4.mol |  |
| | Norcamphor, dehydro- Chemical Properties |
| Melting point | 22-23 °C | | Boiling point | 55-85 °C(Press: 9 Torr) | | density | 1.138±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H8O/c8-7-4-5-1-2-6(7)3-5/h1-2,5-6H,3-4H2 | | InChIKey | HUQXEIFQYCVOPD-UHFFFAOYSA-N | | SMILES | C12CC(C=C1)CC2=O | | NIST Chemistry Reference | Bicyclo[2.2.1]hept-2-en-5-one(694-98-4) |
| | Norcamphor, dehydro- Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 78, p. 2473, 1956 DOI: 10.1021/ja01592a035 |
| | Norcamphor, dehydro- Preparation Products And Raw materials |
|