|
|
| | 2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE Basic information |
| Product Name: | 2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE | | Synonyms: | 2,5-Cyclohexadien-1-one, 2,4,4,6-tetrabromo-;2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE;2,2,4,4-Tetrabromo-2,5-Cyclohexadienone;2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE, 90+%;2,4,4,6-Tetrabromo-2,5-cyclohexadien-1-one95%;2,4,4,6-TetrabroMo-2,5-cyclohexadien-1-one, 95% 5GR;2,4,4,6-TetrabroMocyclohexa-2,5-dien-1-one;2,4,4,6-Tetrabromo-2,5-cyclohexadienone 90% | | CAS: | 20244-61-5 | | MF: | C6H2Br4O | | MW: | 409.7 | | EINECS: | 243-638-7 | | Product Categories: | Bromination;Halogenation;Synthetic Organic Chemistry;C3 to C6;Carbonyl Compounds;Ketones | | Mol File: | 20244-61-5.mol |  |
| | 2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE Chemical Properties |
| Melting point | 120-127 °C | | Boiling point | 365.8±42.0 °C(Predicted) | | density | 2.6462 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | 2-8°C | | solubility | sol CH2Cl2, Et2O, CHCl3, MeNO2, MeOH | | form | Liquid | | color | Clear colorless | | Water Solubility | Insoluble in water. | | BRN | 2048028 | | InChI | 1S/C6H2Br4O/c7-3-1-6(9,10)2-4(8)5(3)11/h1-2H | | InChIKey | NJQJGRGGIUNVAB-UHFFFAOYSA-N | | SMILES | BrC1=CC(Br)(Br)C=C(Br)C1=O | | CAS DataBase Reference | 20244-61-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE Usage And Synthesis |
| Chemical Properties | orange to brown fine crystalline powder | | Uses | 2,4,4,6-Tetrabromo-2,5-cyclohexadienone was used as catalyst for efficient deoxygenation of sulfoxides to their corresponding sulfides with 1,3-dithiane. It was also used as reagent for conversion of alcohols to azides. | | Preparation | bromination of 2,4,6-tribromophenol with Bromine in acetic acid in the presence of sodium acetate.
 | | General Description | 2,4,4,6-Tetrabromo-2,5-cyclohexadienone forms solid charge-transfer molecular complexes with 4-(aminomethyl)piperidine and their spectroscopic characteristics were studied. | | storage | 2,4,4,6-Tetrabromo-2,5-cyclohexadienone should be kept in a dark vessel, well-protected from light. |
| | 2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE Preparation Products And Raw materials |
| Raw materials | 2,6-Dibromo-4-bromomethyl-phenol-->2,5-Cyclohexadien-1-one, 2,4,6-tribromo-4-methyl--->2,4-DIBROMO-6-(HYDROXYMETHYL)PHENOL-->3,5-DIBROMO-4-HYDROXYBENZYL ALCOHOL-->2,6-Dibromo-4-methylphenol-->2,4,6-Tribromophenol-->Phenol-->4-Hydroxybenzoic acid-->2-Hydroxybenzyl alcohol-->4-Bromophenol-->p-Cresol | | Preparation Products | 4-Bromo-2-nitroaniline-->2-Amino-6-methylpyridine-->2,4,6-TRIBROMOANISOLE |
|