|
|
| | N-Boc-Trans-4-Hydroxy-D-proline methyl ester Basic information |
| Product Name: | N-Boc-Trans-4-Hydroxy-D-proline methyl ester | | Synonyms: | N-BOC-TRANS-4-HYDROXY-D-PROLINE METHYL ESTER;N-Boc-Trans-4-Hydroxy-D-Proline Methyl Este;Boc-trans-D-Hyp-OMe;(2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate;(2R,4S)-4-Hydroxypyrrolidine-1,2-dicarboxylic acid 1-tert-butyl ester 2-Methyl ester (N-Boc-trans-4-Hydroxy-D-proline Methyl ester;1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-diMethylethyl) 2-Methyl ester, (2R,4S)-;Boc-trans-4-Hydroxy-D-proline Methyl ester;N-tert-butoxycarbonyl-trans-4-hydroxy-D-proline Methyl ester | | CAS: | 135042-17-0 | | MF: | C11H19NO5 | | MW: | 245.27 | | EINECS: | 828-101-2 | | Product Categories: | | | Mol File: | 135042-17-0.mol |  |
| | N-Boc-Trans-4-Hydroxy-D-proline methyl ester Chemical Properties |
| Boiling point | 335.2±42.0 °C(Predicted) | | density | 1.216±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 2-8°C | | pka | 14.27±0.40(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C11H19NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h7-8,13H,5-6H2,1-4H3/t7-,8+/m0/s1 | | InChIKey | MZMNEDXVUJLQAF-JGVFFNPUSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C[C@@H](O)C[C@@H]1C(OC)=O | | CAS DataBase Reference | 135042-17-0 |
| | N-Boc-Trans-4-Hydroxy-D-proline methyl ester Usage And Synthesis |
| Uses |
N-Boc-Trans-4-Hydroxy-D-proline methyl ester is a valuable organic compound that could be used to synthesis 1-tert-Butyl 2-methyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate.
| | Application | N-Boc-Trans-4-Hydroxy-D-proline methyl ester is mainly used as a chiral building block in drug development and organic synthesis, especially as a non-cleaving linker in the synthesis of antibody-drug conjugates (ADCs), and plays a key role in proteomics research, peptide synthesis and the development of complex bioactive molecules. | | IC 50 | Non-cleavable Linker |
| | N-Boc-Trans-4-Hydroxy-D-proline methyl ester Preparation Products And Raw materials |
| Raw materials | 1,2-Pyrrolidinedicarboxylic acid, 4-[(4-nitrobenzoyl)oxy]-, 1-(1,1-dimethylethyl) 2-methyl ester, (2R,4S)--->(2S,4R)-methyl 4-hydroxypyrrolidine-2-carboxylate hydrochloride-->(2R,4S)-N-ALPHA-T-BUTOXYCARBONYL-4-HYDROXYPYRROLIDINE-2-CARBOXYLIC ACID-->Di-tert-butyl dicarbonate-->Iodomethane | | Preparation Products | (2R,4R)-4-Phenoxy-1,2-pyrrolidinedicarboxylic acid1-(1,1-dimethylethyl)-2-methylester |
|