2-CHLORO-1,1-DIFLUOROETHANE manufacturers
|
| | 2-CHLORO-1,1-DIFLUOROETHANE Basic information |
| Product Name: | 2-CHLORO-1,1-DIFLUOROETHANE | | Synonyms: | 1-chloro-2,2-difluoroethane;2-Chlor-1,1-difluorethan;Ethane,2-chloro-1,1-difluoro;ethane,2-chloro-1,1-difluoro-;2-CHLORO-1,1-DIFLUOROETHANE;2-CDE;2-CHLORO-1,1-DIFLUOROETHANE, 97% MIN.;1,1-Difluoro-2-chloroethane | | CAS: | 338-65-8 | | MF: | C2H3ClF2 | | MW: | 100.5 | | EINECS: | 688-133-6 | | Product Categories: | HCFC | | Mol File: | 338-65-8.mol |  |
| | 2-CHLORO-1,1-DIFLUOROETHANE Chemical Properties |
| Boiling point | 35,1°C | | density | 1.312 | | vapor pressure | 53-170kPa at 20-50℃ | | refractive index | 1.3528 | | InChI | InChI=1S/C2H3ClF2/c3-1-2(4)5/h2H,1H2 | | InChIKey | ATEBGNALLCMSGS-UHFFFAOYSA-N | | SMILES | C(F)(F)CCl | | LogP | 1.3 at 23℃ and pH6.2 | | EPA Substance Registry System | Ethane, 2-chloro-1,1-difluoro- (338-65-8) |
| Hazard Codes | F | | Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | 1993 | | Hazard Note | Flammable |
| | 2-CHLORO-1,1-DIFLUOROETHANE Usage And Synthesis |
| | 2-CHLORO-1,1-DIFLUOROETHANE Preparation Products And Raw materials |
|