|
|
| | Dimethyl aminoterephthalate Basic information |
| | Dimethyl aminoterephthalate Chemical Properties |
| Melting point | 127-130 °C (lit.) | | Boiling point | 348.55°C (rough estimate) | | density | 0.53 g/cm3 (23℃) | | vapor pressure | 0.007Pa at 20℃ | | refractive index | 1.5400 (estimate) | | storage temp. | Store below +30°C. | | solubility | 0.04g/l insoluble | | form | Powder or Crystals | | pka | 1.26±0.10(Predicted) | | color | Beige or yellow to light green to brownish | | PH | 6.9 (10g/l, H2O, 20℃) | | Water Solubility | Insoluble in water. | | BRN | 2808505 | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | InChI | 1S/C10H11NO4/c1-14-9(12)6-3-4-7(8(11)5-6)10(13)15-2/h3-5H,11H2,1-2H3 | | InChIKey | DSSKDXUDARIMTR-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(c(N)c1)C(=O)OC | | LogP | 2.32 at 23℃ and pH7 | | CAS DataBase Reference | 5372-81-6(CAS DataBase Reference) | | NIST Chemistry Reference | Aminoterephthalic acid, dimethyl ester(5372-81-6) | | EPA Substance Registry System | Dimethyl 2-aminoterephthalate (5372-81-6) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36/37/39-22-36/37 | | WGK Germany | 2 | | RTECS | CZ4340000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29224995 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 |
| | Dimethyl aminoterephthalate Usage And Synthesis |
| Chemical Properties | slight yellow crystalline powder | | Uses | Dimethyl aminoterephthalate is used in the preparation of imidazotetrazinones as probes for the action of temozolomide. It is also used to prepare aminoquinazolines with neurokinin-2 receptor antagonist activity. | | General Description | The tricarbonylchromium complex of dimethyl aminoterephthalate was prepared and studied. |
| | Dimethyl aminoterephthalate Preparation Products And Raw materials |
|