- Zinc carbonate basic
-
- $10.00
-
2026-03-20
- CAS:5263-02-5
- Min. Order: 1kg
- Purity: 99.5%
- Supply Ability: 100 TON
- Zinc carbonate basic
-
- $1.00
-
2024-04-27
- CAS:5263-02-5
- Min. Order: 1KG
- Purity: 99.91%
- Supply Ability: 200000
|
| | Zinc carbonate basic Basic information |
| Product Name: | Zinc carbonate basic | | Synonyms: | Zinc carbonate basic, 97%, Zn >57.0%;ZINC CARBONATE HYDROXIDE, 58%, POWDER, (53% ZN MIN.), EXTRA PURE;Zinc carbonate hydroxide,58%,extra pure,powder, (53% Zn min.);Zinc carbonate basic, 97%, Zn >58.0%;Zinc carbonate hydroxide, (53% Zn min.);ZINC CARBONATE BASIC;Zinc carbonate hydroxide, powder, (53% Zn min.), extra pure, 58%;Zinc carbonate basic Vetec(TM) reagent grade | | CAS: | 5263-02-5 | | MF: | CHO4Zn-3 | | MW: | 142.4 | | EINECS: | 226-076-7 | | Product Categories: | | | Mol File: | 5263-02-5.mol |  |
| | Zinc carbonate basic Chemical Properties |
| Melting point | 300 °C | | density | 4.398 | | solubility | water: insoluble | | form | Fine Crystalline Powder | | Specific Gravity | 4.398 | | color | White | | Odor | Odorless | | PH Range | 9.5 at 50 g/l at 20 °C | | Water Solubility | Insoluble in water. | | Decomposition | 300 °C | | InChI | InChI=1S/CH2O3.H2O.Zn/c2-1(3)4;;/h(H2,2,3,4);1H2;/p-3 | | InChIKey | PFBRLXQYBHQKKW-UHFFFAOYSA-K | | SMILES | C([O-])([O-])=O.[Zn].[OH-] |
| Risk Statements | 53 | | WGK Germany | 2 | | HS Code | 28369917 | | Storage Class | 11 - Combustible Solids |
| | Zinc carbonate basic Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | Zinc carbonate basic (basic zinc carbonate, [ZnCO3]2.[Zn(OH)2]3) may be used in the preparation of ZnO nanopowder. It may be employed as a catalyst for the synthesis of methyl phenylcarbamate, via reaction between aniline and dimethyl carbonate. | | Uses | Zinc carbonate basic is used as pharmaceutical intermediate and in chemical research. |
| | Zinc carbonate basic Preparation Products And Raw materials |
|