| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:4-(3’,6’-Dimethyl-3’-heptyl)phenol diethoxylate-13C6
CAS:1173019-36-7
Purity:NULL Package:2.5mg;5mg Remarks:NULL
|
| Company Name: |
LGC Science (Shanghai) Ltd.
|
| Tel: |
17717235263 |
| Email: |
fan.yang@LGCgroup.com |
| Products Intro: |
Product Name:4-(3’,6’-Dimethyl-3’-heptyl)phenol diethoxylate-13C6
CAS:1173019-36-7
Purity:具體純度，見COA Package:2.5mg Remarks:TRC-D473137
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:4-(3,6-Dimethyl-3-heptyl)phenol-diethoxylate-ring-13C6 solution
CAS:1173019-36-7
|
| Company Name: |
Santa Cruz Biotechnology Inc
|
| Tel: |
021-60936350 |
| Email: |
scbt@scbt.com |
| Products Intro: |
Product Name:4-(3,6-Dimethyl-3-heptyl)phenol-diethoxylate-ring-13C6 solution
CAS:1173019-36-7
|
|
| | 3,6,3-Nonylphenol diethoxylate-13C6, 363-NP2EO-13C6, 2-{2-[4-(3,6-Dimethyl-3-heptyl)phenoxy]ethoxy}ethanol-13C6, 2-{2-[4-(1-Ethyl-1,4-dimethylpentyl)phenoxy]ethoxy}ethanol-13C6 Basic information |
| Product Name: | 3,6,3-Nonylphenol diethoxylate-13C6, 363-NP2EO-13C6, 2-{2-[4-(3,6-Dimethyl-3-heptyl)phenoxy]ethoxy}ethanol-13C6, 2-{2-[4-(1-Ethyl-1,4-dimethylpentyl)phenoxy]ethoxy}ethanol-13C6 | | Synonyms: | 363-NP2EO-13C6;3,6,3-Nonylphenol diethoxylate-13C6, 363-NP2EO-13C6, 2-{2-[4-(3,6-Dimethyl-3-heptyl)phenoxy]ethoxy}ethanol-13C6, 2-{2-[4-(1-Ethyl-1,4-dimethylpentyl)phenoxy]ethoxy}ethanol-13C6;4-(3,6-Dimethyl-3-heptyl)phenol-diethoxylate-13C6 (ring 13C6) solution;4-(3,6-Dimethyl-3-heptyl)phenol-diethoxylate-ring-13C6 solution
;4-(3’,6’-Dimethyl-3’-heptyl)phenol diethoxylate-13C6;4-(3,6-Dimethyl-3-heptyl)phenol-diethoxylate-ring-13C6 solution;Ethanol, 2-[2-[4-(1-ethyl-1,4-dimethylpentyl)phenoxy-1,2,3,4,5,6-13C6]ethoxy]- | | CAS: | 1173019-36-7 | | MF: | C19H32O3 | | MW: | 314.50958 | | EINECS: | 687-859-0 | | Product Categories: | | | Mol File: | 1173019-36-7.mol | ![3,6,3-Nonylphenol diethoxylate-13C6, 363-NP2EO-13C6, 2-{2-[4-(3,6-Dimethyl-3-heptyl)phenoxy]ethoxy}ethanol-13C6, 2-{2-[4-(1-Ethyl-1,4-dimethylpentyl)phenoxy]ethoxy}ethanol-13C6 Structure](CAS/20180906/GIF/1173019-36-7.gif) |
| | 3,6,3-Nonylphenol diethoxylate-13C6, 363-NP2EO-13C6, 2-{2-[4-(3,6-Dimethyl-3-heptyl)phenoxy]ethoxy}ethanol-13C6, 2-{2-[4-(1-Ethyl-1,4-dimethylpentyl)phenoxy]ethoxy}ethanol-13C6 Chemical Properties |
| Fp | -17 °C | | storage temp. | −20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Major Application | environmental | | InChI | 1S/C19H32O3/c1-5-19(4,11-10-16(2)3)17-6-8-18(9-7-17)22-15-14-21-13-12-20/h6-9,16,20H,5,10-15H2,1-4H3/i6+1,7+1,8+1,9+1,17+1,18+1 | | InChIKey | MXEUZASFOXCTSR-XMEDIYHRSA-N | | SMILES | CCC(C)(CCC(C)C)[13c]1[13cH][13cH][13c](OCCOCCO)[13cH][13cH]1 |
| Hazard Codes | F,Xi | | Risk Statements | 11-36-66-67 | | Safety Statements | 9-16-26 | | RIDADR | UN 1090 3/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2
STOT SE 3 |
| | 3,6,3-Nonylphenol diethoxylate-13C6, 363-NP2EO-13C6, 2-{2-[4-(3,6-Dimethyl-3-heptyl)phenoxy]ethoxy}ethanol-13C6, 2-{2-[4-(1-Ethyl-1,4-dimethylpentyl)phenoxy]ethoxy}ethanol-13C6 Usage And Synthesis |
| Uses | 4-(3’,6’-Dimethyl-3’-heptyl)phenol diethoxylate-13C6 (cas# 1173019-36-7) is a compound useful in organic synthesis. |
| | 3,6,3-Nonylphenol diethoxylate-13C6, 363-NP2EO-13C6, 2-{2-[4-(3,6-Dimethyl-3-heptyl)phenoxy]ethoxy}ethanol-13C6, 2-{2-[4-(1-Ethyl-1,4-dimethylpentyl)phenoxy]ethoxy}ethanol-13C6 Preparation Products And Raw materials |
|