| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2-Dicyclohexylphosphino-2′,4′,6′-triisopropylbiphenyl gold(I) bis(trifluoroMethanesulfonyl)iMide
CAS:934506-10-2
Package:1G,250MG
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:2-Dicyclohexylphosphino-2′,4′,6′-triisopropylbiphenyl gold(I) bis(trifluoromethanesulfonyl)imide
CAS:934506-10-2
Remarks:RA10260008
|
| Company Name: |
Nanjin Cynthia chemicals Technology Co.,Ltd
|
| Tel: |
0550-5618439 15951861180 |
| Email: |
cynthiachem@163.com |
| Products Intro: |
Product Name:2-Dicyclohexylphosphino-2μ,4μ,6μ-triisopropylbiphenyl gold(I) bis(trifluoromethanesulfonyl)imide
CAS:934506-10-2
Purity:98% HPLC Package:1G;50G;100G;1KG
|
|
| | 2-Dicyclohexylphosphino-2μ,4μ,6μ-triisopropylbiphenyl gold(I) bis(trifluoromethanesulfonyl)imide Basic information |
| Product Name: | 2-Dicyclohexylphosphino-2μ,4μ,6μ-triisopropylbiphenyl gold(I) bis(trifluoromethanesulfonyl)imide | | Synonyms: | 2-Dicyclohexylphosphino-2μ,4μ,6μ-triisopropylbiphenyl gold(I) bis(trifluoromethanesulfonyl)imide;XPhos AuNTf2;bis(trifluoromethylsulfonyl)azanide:dicyclohexyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane:gold(1+);2-Dicyclohexylphosphino-2',4',6'-triisopropylbiphenyl gold(I...;2-Dicyclohexylphosphino-2',4',6'-triisopropylbiphenyl gold(I) bis(trifluoromethanesulfonyl)imide;2-dicyclohexylphosphino-2′,4′,6′-trisopropylbiphenylgold(I) bis(trifluoromethanesulfonylacyl)isoamine | | CAS: | 934506-10-2 | | MF: | C35H50AuF6NO4PS2 | | MW: | 954.84 | | EINECS: | | | Product Categories: | Au;Catalysis and Inorganic Chemistry;Chemical Synthesis;Gold Catalysis;Gold Catalysts;GoldCatalysis and Inorganic Chemistry | | Mol File: | 934506-10-2.mol |  |
| | 2-Dicyclohexylphosphino-2μ,4μ,6μ-triisopropylbiphenyl gold(I) bis(trifluoromethanesulfonyl)imide Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder | | Appearance | Off-white to gray Solid | | InChIKey | GMVGZINKTXAKDT-UHFFFAOYSA-N | | SMILES | FC(F)(F)S(=O)(=O)N([Au])S(=O)(=O)C(F)(F)F.CC(C)c1cc(C(C)C)c(c(c1)C(C)C)-c2ccccc2P(C3CCCCC3)C4CCCCC4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2
STOT SE 3 |
| | 2-Dicyclohexylphosphino-2μ,4μ,6μ-triisopropylbiphenyl gold(I) bis(trifluoromethanesulfonyl)imide Usage And Synthesis |
| Uses | Gold Catalysts — 21st Century ′Gold Rush′
- Catalyst for isomerization of allenyl carbinol esters, hydroxy- and methoxycyclization, cycloisomerisation of diynes
| | reaction suitability | core: gold
reagent type: catalyst |
| | 2-Dicyclohexylphosphino-2μ,4μ,6μ-triisopropylbiphenyl gold(I) bis(trifluoromethanesulfonyl)imide Preparation Products And Raw materials |
|