|
|
| | 3-(N,N-Diethylamino)acetanilide Basic information |
| | 3-(N,N-Diethylamino)acetanilide Chemical Properties |
| Melting point | 81-84 °C(lit.) | | Boiling point | 385.6±25.0 °C(Predicted) | | density | 1.065±0.06 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 25℃ | | pka | 14.82±0.70(Predicted) | | Water Solubility | 700mg/L at 20℃ | | InChI | InChI=1S/C12H18N2O/c1-4-14(5-2)12-8-6-7-11(9-12)13-10(3)15/h6-9H,4-5H2,1-3H3,(H,13,15) | | InChIKey | FPUKYOSOAAPHTN-UHFFFAOYSA-N | | SMILES | N(C1C=CC=C(C=1)NC(=O)C)(CC)CC | | LogP | 2.26 at 25℃ | | CAS DataBase Reference | 6375-46-8(CAS DataBase Reference) | | EPA Substance Registry System | Acetamide, N-[3-(diethylamino)phenyl]- (6375-46-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-(N,N-Diethylamino)acetanilide Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | 3-(N,N-Diethylamino)acetanilide Preparation Products And Raw materials |
|