| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Bis(N-diazo)-tris(O-acetyl)-2-deoxystreptaMine CAS:90852-19-0 Purity:>=97% (HPLC) Package:250MG
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Bis(N-diazo)-tris(O-acetyl)-2-deoxystreptamine CAS:90852-19-0 Purity:>=97% (HPLC) Package:250MG Remarks:714224-250MG
|
| Company Name: |
Pushan Industry (Shaanxi) Co., Ltd.
|
| Tel: |
029-81310890 18165209495 |
| Email: |
2929288192@qq.com |
| Products Intro: |
Product Name:2-DOS DIAZIDE TRIACETATE CAS:90852-19-0 Purity:99% Package:25kg
|
|
| | 2-DOS DIAZIDE TRIACETATE Basic information |
| Product Name: | 2-DOS DIAZIDE TRIACETATE | | Synonyms: | 2-DOS DIAZIDE TRIACETATE;4T,6T-DIAZIDOCYCLOHEXANE-1R,2T,3C-TRIYL TRIACETATE;(1α2βb,3α4β6β)-4,6-Diazido-1,2,3-cyclohexanetriol triacetate;BIS(N-DIAZO)-TRIS(O-ACETYL)-2-DEOXYSTREPTAMINE;(1S,3R,4S,6R)-2,3-diacetyloxy-4,6-diazidocyclohexyl]acetate;Bis(N-diazo)-tris(O-acetyl)-2-deoxystreptamine | | CAS: | 90852-19-0 | | MF: | C12H16N6O6 | | MW: | 340.3 | | EINECS: | | | Product Categories: | Carbohydrate Derivatives;Aliphatic Azides;Azides;Building Blocks;Chemical Biology;Chemical Synthesis;Carbohydrate Chemistry;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 90852-19-0.mol |  |
| | 2-DOS DIAZIDE TRIACETATE Chemical Properties |
| storage temp. | 2-8°C | | form | crystals | | BRN | 5639286 | | InChI | 1S/C12H16N6O6/c1-5(19)22-10-8(15-17-13)4-9(16-18-14)11(23-6(2)20)12(10)24-7(3)21/h8-12H,4H2,1-3H3/t8-,9+,10+,11-,12- | | InChIKey | SQKWPVVWVBKSIG-CSPFCNMYSA-N | | SMILES | CC(=O)O[C@H]1[C@@H](C[C@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@@H]1OC(C)=O)N=[N+]=[N-] |
| WGK Germany | 3 | | HS Code | 9999999999 | | Storage Class | 11 - Combustible Solids |
| | 2-DOS DIAZIDE TRIACETATE Usage And Synthesis |
| | 2-DOS DIAZIDE TRIACETATE Preparation Products And Raw materials |
|