|
|
| | trans-4-Aminoadamantan-1-ol hydrochloride Basic information |
| Product Name: | trans-4-Aminoadamantan-1-ol hydrochloride | | Synonyms: | trans-4-Aminoadamantan-1-ol hydrochloride;trans-4-Aminoadamantan-1-ol HCL;rel-(1R,4R)-4-aMinoadaMantan-1-ol hydrochloride;trans-4-AMino-1-adaMantanol Hydrochloride;trans-4-AMino-1-HydroadaMantane Hydrochloride;trans-4-Amino-1-adamantanol Hydrochloride;trans-4-Aminoadamantan-1-ol HCl 98%;trans-4-Amino-1-adamantanol Hydrochloride > | | CAS: | 62075-23-4 | | MF: | C10H18ClNO | | MW: | 203.71 | | EINECS: | 1806241-263-5 | | Product Categories: | | | Mol File: | 62075-23-4.mol |  |
| | trans-4-Aminoadamantan-1-ol hydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C10H17NO.ClH/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7;/h6-9,12H,1-5,11H2;1H | | InChIKey | KWEPNQFVPHYHHO-CYTPCPCVSA-N | | SMILES | OC12CC3CC(C(N)C(C3)C1)C2.Cl |
| | trans-4-Aminoadamantan-1-ol hydrochloride Usage And Synthesis |
| | trans-4-Aminoadamantan-1-ol hydrochloride Preparation Products And Raw materials |
|