|
|
| | 1,4-Bis[(trimethylsilyl)ethynyl]benzene Basic information |
| Product Name: | 1,4-Bis[(trimethylsilyl)ethynyl]benzene | | Synonyms: | TIMTEC-BB SBB009009;1,4-BIS[(TRIMETHYLSILYL)ETHYNYL]BENZENE;1,4-BIS((TRIMETHYLSILYL)ETHYNYL)BENZENE 98%;1,4-Bis(trimethylsilyl)ethynylübenzene, 98%;1,4-Bis[(trimethylsilyl)ethynyl]benzene,98%;1,4-Bis(trimethylsilyl)ethynylubenzene;1,4-bis[2-(trimethylsilyl)ethynyl]Benzene;1,4-BIS-(TRIMETHYLSILYLETHYNYL)BENZENE, 98%1,4-BIS-(TRIMETHYLSILYLETHYNYL)BENZENE, 98%1,4-BIS-(TRIMETHYLSILYLETHYNYL)BENZENE, 98% | | CAS: | 17938-13-5 | | MF: | C16H22Si2 | | MW: | 270.52 | | EINECS: | 000-000-0 | | Product Categories: | Alkynes;Internal;Organic Building Blocks | | Mol File: | 17938-13-5.mol | ![1,4-Bis[(trimethylsilyl)ethynyl]benzene Structure](CAS/GIF/17938-13-5.gif) |
| | 1,4-Bis[(trimethylsilyl)ethynyl]benzene Chemical Properties |
| Melting point | 119 °C | | storage temp. | 2-8°C | | form | solid | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | BRN | 2840618 | | InChI | 1S/C16H22Si2/c1-17(2,3)13-11-15-7-9-16(10-8-15)12-14-18(4,5)6/h7-10H,1-6H3 | | InChIKey | CMTMWEXUJQSPCA-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)C#Cc1ccc(cc1)C#C[Si](C)(C)C | | CAS DataBase Reference | 17938-13-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 13 - Non Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 1,4-Bis[(trimethylsilyl)ethynyl]benzene Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | 1,4-Bis[(trimethylsilyl)ethynyl]benzene is a diyne that can be prepared by the reduction of 1,4-bis[(trimethylsilyl)ethynyl]-2,5-cyclohexadiene-1,4-diol with stannous chloride. It reacts with di(tert-butyl)aluminium hydride by hydroalumination and undergoes addition of one Al-H bond to each C-C triple bond. | | General Description | 1,4-Bis[(trimethylsilyl)ethynyl]benzene is a diyne that can be prepared by the reduction of 1,4-bis[(trimethylsilyl)ethynyl]-2,5-cyclohexadiene-1,4-diol with stannous chloride. It reacts with di(tert-butyl)aluminium hydride by hydroalumination and undergoes addition of one Al-H bond to each C-C triple bond. |
| | 1,4-Bis[(trimethylsilyl)ethynyl]benzene Preparation Products And Raw materials |
|