|
|
| | [3-[[[2-(DiaMinoMethyleneaMino)-4-thiazolyl]Methyl]thio]propionyl]sulfaMide Hydrochloride (FaMotidine IMpurity) Basic information |
| | [3-[[[2-(DiaMinoMethyleneaMino)-4-thiazolyl]Methyl]thio]propionyl]sulfaMide Hydrochloride (FaMotidine IMpurity) Chemical Properties |
| Melting point | 148-150°C (dec.) | | storage temp. | -20°C Freezer | | solubility | Methanol (Slightly) | | form | Solid | | color | White to Off-White | | biological source | synthetic | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C8H14N6O3S3.ClH/c9-7(10)13-8-12-5(4-19-8)3-18-2-1-6(15)14-20(11,16)17;/h4H,1-3H2,(H,14,15)(H2,11,16,17)(H4,9,10,12,13);1H | | InChIKey | LBBLJRHWJZWHQA-UHFFFAOYSA-N | | SMILES | Cl.s1c(/N=C(\N)/N)nc(CSCCC(=O)NS(=O)(=O)N)c1 |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids |
| | [3-[[[2-(DiaMinoMethyleneaMino)-4-thiazolyl]Methyl]thio]propionyl]sulfaMide Hydrochloride (FaMotidine IMpurity) Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | An intermediate in the synthesis of the metabolite of the drug Famotidine. |
| | [3-[[[2-(DiaMinoMethyleneaMino)-4-thiazolyl]Methyl]thio]propionyl]sulfaMide Hydrochloride (FaMotidine IMpurity) Preparation Products And Raw materials |
|