|
|
| | Cephalexin Sulfoxide Basic information |
| | Cephalexin Sulfoxide Chemical Properties |
| Melting point | >179°C (dec.) | | Boiling point | 830.979±65.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.597±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO, Methanol | | form | Solid | | pka | 2.909±0.40(predicted) | | color | Off-White | | Stability: | Unstable in Solution | | InChI | InChI=1/C16H17N3O5S/c1-8-7-25(24)15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-6,10-11,15H,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-,25/s3 | | InChIKey | GAMHLNJQISGSQF-KFAWQCHLNA-N | | SMILES | CC1CS(=O)[C@]2([H])[C@@H](C(=O)N2C=1C(=O)O)NC(=O)[C@@H](C1=CC=CC=C1)N |&1:5,7,18,r| |
| | Cephalexin Sulfoxide Usage And Synthesis |
| Uses | Cephalexin sulfoxide is a derivative of Cephalexin, a Cephalosporin derivative with bactericidal activity. |
| | Cephalexin Sulfoxide Preparation Products And Raw materials |
|