|
|
| | 1-Isopropyl-1H-pyrazole-5-boronic acid, pinacol ester Basic information |
| Product Name: | 1-Isopropyl-1H-pyrazole-5-boronic acid, pinacol ester | | Synonyms: | 1-Isopropyl-1H-pyrazole-5-boronic acid, pinacol ester;1-Isopropylpyrazole-5-boronic Acid Pinacol Ester;(1-Isopropyl-1H-Pyrazol-5-YL)Boronic Acid Pinacol Ester;3-hydroxy-2,3-dimethylbutan-2-yl hydrogen (1-isopropyl-1H-pyrazol-5-yl)boronate;1-Isopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl);1H-Pyrazole, 1-(1-Methylethyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-;1-(propan-2-yl)-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;1-(1-Methylethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole | | CAS: | 1282518-60-8 | | MF: | C12H21BN2O2 | | MW: | 236.12 | | EINECS: | | | Product Categories: | | | Mol File: | 1282518-60-8.mol |  |
| | 1-Isopropyl-1H-pyrazole-5-boronic acid, pinacol ester Chemical Properties |
| Boiling point | 327.3±15.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 1.98±0.10(Predicted) | | form | solid | | color | White to off-white | | InChI | InChI=1S/C12H21BN2O2/c1-9(2)15-10(7-8-14-15)13-16-11(3,4)12(5,6)17-13/h7-9H,1-6H3 | | InChIKey | ZKZJXVGTTZXHGX-UHFFFAOYSA-N | | SMILES | N1(C(C)C)C(B2OC(C)(C)C(C)(C)O2)=CC=N1 |
| | 1-Isopropyl-1H-pyrazole-5-boronic acid, pinacol ester Usage And Synthesis |
| Synthesis | 1-Isopropyl-1H-pyrazole-5-boronic acid, pinacol ester could be synthesized through the reaction of 1-isopropyl-1H-pyrazole with 2-isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Tetrahydrofuran could used as an organic solvent. The crude product added n-hexane, heated to 40°C to dissolve the system, cooled to -20°C, stirred and crystallized, and filtered. Vacuum drying to obtain the target compound 1-Isopropyl-1H-pyrazole-5-boronic acid, pinacol ester, with a yield of 77% and a purity of 99.3%.
 |
| | 1-Isopropyl-1H-pyrazole-5-boronic acid, pinacol ester Preparation Products And Raw materials |
|