|
|
| | AMbroxol EP IMpurity D Basic information |
| Product Name: | AMbroxol EP IMpurity D | | Synonyms: | cis-4-[[(2-AMino-3,5-dibroMophenyl)Methyl]aMino]cyclohexanol;Cyclohexanol,4-[[(2-amino-3,5-dibromophenyl)methyl]amino]-,cis-;Ambroxol impurity D HCl;AMbroxol IMpurity D;cis-4-((2-Amino-3,5-dibromobenzyl)amino)cyclohexanol;Ambroxol Impurity 3 Monomer;cis-4-[(2-Amino-3,5-dibromobenzyl)a;Ambroxol EP Impurity D (cis-Ambroxol HCl/ Acebrophylline Impurity D) | | CAS: | 107814-37-9 | | MF: | C13H18Br2N2O | | MW: | 378.1 | | EINECS: | 200-158-5 | | Product Categories: | | | Mol File: | 107814-37-9.mol |  |
| | AMbroxol EP IMpurity D Chemical Properties |
| Melting point | 56-61oC | | Boiling point | 468.6±45.0 °C(Predicted) | | density | 1.70±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 15.12±0.40(Predicted) | | color | Colourless to Beige | | Stability: | Hygroscopic | | InChI | InChI=1S/C13H18Br2N2O/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10/h5-6,10-11,17-18H,1-4,7,16H2/t10-,11+ | | InChIKey | JBDGDEWWOUBZPM-PHIMTYICSA-N | | SMILES | [C@@H]1(O)CC[C@H](NCC2=CC(Br)=CC(Br)=C2N)CC1 |
| | AMbroxol EP IMpurity D Usage And Synthesis |
| Uses | cis-Ambroxol is the cis-isomeric impurity of Ambroxol (A575905). cis-Ambroxol is a metabolite Bromhexine (B678600). | | Definition | ChEBI: Ambroxol is an aromatic amine. |
| | AMbroxol EP IMpurity D Preparation Products And Raw materials |
|