|
|
| | Methyl phenylsulfonylacetate Basic information |
| | Methyl phenylsulfonylacetate Chemical Properties |
| Melting point | 30°C | | Boiling point | 165 °C/0.05 mmHg (lit.) | | density | 1.305 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.535(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid to slightly cloudy liquid | | Specific Gravity | 1.282 | | color | Light orange to Yellow to Green | | Water Solubility | Insoluble in water. | | BRN | 2051463 | | InChI | InChI=1S/C9H10O4S/c1-13-9(10)7-14(11,12)8-5-3-2-4-6-8/h2-6H,7H2,1H3 | | InChIKey | NLEAIFBNKPYTGN-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CS(C1=CC=CC=C1)(=O)=O | | CAS DataBase Reference | 34097-60-4(CAS DataBase Reference) |
| | Methyl phenylsulfonylacetate Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid after melting | | Uses | Methyl phenylsulfonylacetate has been used in a key step during the synthesis of (-)-hybridalactone, marine eicosanoid isolated from the red alga Laurencia hybrida, in dehydrative alkylation of alcohols under modified Mitsunobu conditions followed by desulfonylation using magnesium, in three step synthesis of 2-(hydroxymethyl)indene. |
| | Methyl phenylsulfonylacetate Preparation Products And Raw materials |
|