benzyl 4-((chlorosulfonyl)Methyl)piperidine-1-carboxylate manufacturers
|
| | benzyl 4-((chlorosulfonyl)Methyl)piperidine-1-carboxylate Basic information |
| Product Name: | benzyl 4-((chlorosulfonyl)Methyl)piperidine-1-carboxylate | | Synonyms: | benzyl 4-((chlorosulfonyl)Methyl)piperidine-1-carboxylate;1-Piperidinecarboxylic acid, 4-[(chlorosulfonyl)methyl]-, phenylmethyl ester;Phenylmethyl 4-[(chlorosulfonyl)methyl]-1-piperidinecarboxylate;1-Cbz-4-[(chlorosulfonyl)methyl]piperidine;4-[(CHLOROSULFONYL)METHYL]PIPERIDINE-1-CARBOXYLATE | | CAS: | 1211587-42-6 | | MF: | C14H18ClNO4S | | MW: | 331.82 | | EINECS: | | | Product Categories: | | | Mol File: | 1211587-42-6.mol |  |
| | benzyl 4-((chlorosulfonyl)Methyl)piperidine-1-carboxylate Chemical Properties |
| Boiling point | 471.5±28.0 °C(Predicted) | | density | 1.330±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | -2.28±0.40(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C14H18ClNO4S/c15-21(18,19)11-13-6-8-16(9-7-13)14(17)20-10-12-4-2-1-3-5-12/h1-5,13H,6-11H2 | | InChIKey | JOQRDARBUIIJCV-UHFFFAOYSA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)CCC(CS(Cl)(=O)=O)CC1 | | CAS DataBase Reference | 1211587-42-6 |
| | benzyl 4-((chlorosulfonyl)Methyl)piperidine-1-carboxylate Usage And Synthesis |
| Uses | 4-[(Chlorosulfonyl)methyl]-1-piperidinecarboxylic Acid Phenylmethyl Ester is an intermediate used in the synthesis of EPZ031686, the first orally bioavailable small molecule SMYD3 inhibitor. |
| | benzyl 4-((chlorosulfonyl)Methyl)piperidine-1-carboxylate Preparation Products And Raw materials |
|