| Company Name: |
Shanghai Acmec Biochemical Technology Co., Ltd. |
| Tel: |
+86-18621343501 |
| Email: |
product@acmec-e.com |
| Products Intro: |
Product Name:(S)-2,2'-Bis[bis(3,5-dimethylphenyl)phosphino]-4,4',6,6'-tetramethoxy)-1,1'-biphenyl CAS:1365531-90-3 Purity:98% Package:100mg, 1g, 50mg, 250mg
|
|
|
|
|
|
| | (S)-2,2'-Bis[bis(3,5-diMethylphenyl)phosphino]-4,4',6,6'-tetraMethoxybiphenyl Basic information | | Reaction |
| Product Name: | (S)-2,2'-Bis[bis(3,5-diMethylphenyl)phosphino]-4,4',6,6'-tetraMethoxybiphenyl | | Synonyms: | (S)-2,2'-Bis[bis(3,5-diMethylphenyl)phosphino]-4,4',6,6'-tetraMethoxybiphenyl, 97+%;(S)-2,2'-Bis[bis(3,5-diMethylphenyl)phosphino]-4,4',6,6'-tetraMethoxybiphenyl, Min. 97% (S)-Xyl-Garphos;(S)-2,2'-Bis[bis(3,5-dimethylphenyl)phosphino]-4,4',6,6'-tetramethoxy)-1,1'-biphenyl;(S)-2,2'-BIS[BIS(3,5-DIMETHYLPHENYL)PHOSPHINO]-4,4',6,6'-TETRAMETHOXY)-1,1'-BIPHENYL,MIN.97%(S)-XYL-GARPHOS;(S)-2,2'-Bis[bis(3,5-dimethylphenyl)phosphino]-4,4',6,6'-tetramethoxy)-1,1'-biphenyl, min. 97% (S)-Xyl-Garphos(TM);(S)-2,2'-Bis[bis(3,5-diMethylphenyl)phosphino]-4,4',6,6'-tetraMethoxybiphenyl (S)-Xyl-Garphos;Phosphine, 1,1'-[(1S)-4,4',6,6'-tetramethoxy[1,1'-biphenyl]-2,2'-diyl]bis[1,1-bis(3,5-dimethylphenyl)-;(S)-2,2''-Bis[bis(3,5-dimethyL | | CAS: | 1365531-90-3 | | MF: | C48H52O4P2 | | MW: | 754.87 | | EINECS: | | | Product Categories: | Chiral Phosphine;Garphos Series | | Mol File: | 1365531-90-3.mol | ![(S)-2,2'-Bis[bis(3,5-diMethylphenyl)phosphino]-4,4',6,6'-tetraMethoxybiphenyl Structure](CAS/20150408/GIF/1365531-90-3.gif) |
| | (S)-2,2'-Bis[bis(3,5-diMethylphenyl)phosphino]-4,4',6,6'-tetraMethoxybiphenyl Chemical Properties |
| Melting point | >300 °C | | Boiling point | 810.8±65.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | white | | Optical Rotation | [α]22/D -87.0, c =0.5% in chloroform | | Sensitive | Air Sensitive | | InChIKey | IDNKFBDRZBLTFQ-UHFFFAOYSA-N | | SMILES | COc1cc(OC)c(c(c1)P(c2cc(C)cc(C)c2)c3cc(C)cc(C)c3)-c4c(OC)cc(OC)cc4P(c5cc(C)cc(C)c5)c6cc(C)cc(C)c6 | | CAS DataBase Reference | 1365531-90-3 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-2,2'-Bis[bis(3,5-diMethylphenyl)phosphino]-4,4',6,6'-tetraMethoxybiphenyl Usage And Synthesis |
| Reaction | Chiral ligand used in the preparation of hydrogenation catalysts with exceptionally high activity and selectivity.
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | (S)-2,2'-Bis[bis(3,5-diMethylphenyl)phosphino]-4,4',6,6'-tetraMethoxybiphenyl Preparation Products And Raw materials |
|