|
|
| | 1,4-Dinitrosobenzene Basic information |
| Product Name: | 1,4-Dinitrosobenzene | | Synonyms: | 1,4-dinitroso-benzen;Benzene, 1,4-dinitroso-;Benzene, p-dinitroso-;p-dinitroso-benzen;rd3435-49;1,4-DINITROSOBENZENE;Dinitrosobenzene;PARA-DINITROSOBENZENE | | CAS: | 105-12-4 | | MF: | C6H4N2O2 | | MW: | 136.11 | | EINECS: | 203-272-0 | | Product Categories: | Miscellaneous | | Mol File: | 105-12-4.mol |  |
| | 1,4-Dinitrosobenzene Chemical Properties |
| Melting point | 178-180 °C (decomp) | | Boiling point | 250.35°C (rough estimate) | | density | 1.4175 (rough estimate) | | refractive index | 1.4738 (estimate) | | InChI | InChI=1S/C6H4N2O2/c9-7-5-1-2-6(8-10)4-3-5/h1-4H | | InChIKey | MKZXROSCOHNKDX-UHFFFAOYSA-N | | SMILES | C1(N=O)=CC=C(N=O)C=C1 | | NIST Chemistry Reference | P-dinitrosobenzene(105-12-4) | | EPA Substance Registry System | p-Dinitrosobenzene (105-12-4) |
| RIDADR | UN 0406 | | TSCA | TSCA listed | | HazardClass | 1.3C |
| | 1,4-Dinitrosobenzene Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 25, p. 1901, 1960 DOI: 10.1021/jo01081a019 |
| | 1,4-Dinitrosobenzene Preparation Products And Raw materials |
|