|
|
| | Methyl 6-chloro-5-methylpyridine-3-carboxylate Basic information |
| | Methyl 6-chloro-5-methylpyridine-3-carboxylate Chemical Properties |
| Melting point | 73-74 °C | | Boiling point | 261.8±35.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -1.46±0.10(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C8H8ClNO2/c1-5-3-6(8(11)12-2)4-10-7(5)9/h3-4H,1-2H3 | | InChIKey | VCMFHHZWOQVDEZ-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=C(C)C=C1C(OC)=O |
| | Methyl 6-chloro-5-methylpyridine-3-carboxylate Usage And Synthesis |
| | Methyl 6-chloro-5-methylpyridine-3-carboxylate Preparation Products And Raw materials |
|