MPEG12-N3 manufacturers
- azido-mPEG12
-
-
2025-06-07
- CAS:2170098-29-8
- Min. Order: 1g
- Purity: >95.00%
- Supply Ability: 1g
|
| | MPEG12-N3 Basic information |
| Product Name: | MPEG12-N3 | | Synonyms: | MPEG12-N3;mPEG12-N3/2,5,8,11,14,17,20,23,26,29,32,35-Dodecaoxaheptatriacontane, 37-azido- | | CAS: | 2170098-29-8 | | MF: | C25H51N3O12 | | MW: | 585.69 | | EINECS: | | | Product Categories: | | | Mol File: | 2170098-29-8.mol |  |
| | MPEG12-N3 Chemical Properties |
| storage temp. | 2-8°C, sealed storage, away from moisture | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C25H51N3O12/c1-29-4-5-31-8-9-33-12-13-35-16-17-37-20-21-39-24-25-40-23-22-38-19-18-36-15-14-34-11-10-32-7-6-30-3-2-27-28-26/h2-25H2,1H3 | | InChIKey | FXVJBKLBTILMNA-UHFFFAOYSA-N | | SMILES | C(COCCOCCOCCOCCOCCN=[N+]=[N-])OCCOCCOCCOCCOCCOCCOC |
| | MPEG12-N3 Usage And Synthesis |
| Uses | m-PEG12-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. m-PEG12-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | MPEG12-N3 Preparation Products And Raw materials |
|