3,4-dihydroxy-α-aminoacetophenone hydrochloride manufacturers
|
| | 3,4-dihydroxy-α-aminoacetophenone hydrochloride Basic information |
| Product Name: | 3,4-dihydroxy-α-aminoacetophenone hydrochloride | | Synonyms: | 3,4-dihydroxy-α-aminoacetophenone hydrochloride;2-amino-1-(3,4-dihydroxyphenyl)ethanone,hydrochloride;2-AMINO-1-(3,4-DIHYDROXYPHENYL)ETHANONE,HCL;Norepinephrine EP Impurity B HCl;Norepinephrine Impurity 1;Noradrenaline EP Impurity B HCl;Noradrenaline (Norepinephrine) EP Impurity B;Norepinephrine Impurity 2（Norepinephrine EP Impurity B） | | CAS: | 5090-29-9 | | MF: | C8H10ClNO3 | | MW: | 203.6229 | | EINECS: | | | Product Categories: | | | Mol File: | 5090-29-9.mol |  |
| | 3,4-dihydroxy-α-aminoacetophenone hydrochloride Chemical Properties |
| Melting point | 255 °C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly, Heated), Water (Very Slightly, Heated) | | form | Solid | | color | Dark Yellow to Dark Brown | | InChI | InChI=1S/C8H9NO3.ClH/c9-4-8(12)5-1-2-6(10)7(11)3-5;/h1-3,10-11H,4,9H2;1H | | InChIKey | ILTXTELYZNIJHL-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(O)C(O)=C1)CN.[H]Cl |
| | 3,4-dihydroxy-α-aminoacetophenone hydrochloride Usage And Synthesis |
| Uses | Noradrenalone Hydrochloride is an intermediate of Norepinephrine (N674500), an antagonist of dibutyryl cyclic AMP in the regulation of narcosis. Norepinephrine modulates human dendritic cell activation by altering cytokine release. | | Preparation | Preparation by demethylation of a-amino-3,4-dimethoxy-acetophenone on heating with 37% hydrochloric acid for 2.5 h at 160–165° under carbon dioxide (85%). |
| | 3,4-dihydroxy-α-aminoacetophenone hydrochloride Preparation Products And Raw materials |
|