2-NITROMESITYLENE manufacturers
- 2-NITROMESITYLENE
-
- $75.00
-
2026-07-06
- CAS:603-71-4
- Min. Order: 10kg
- Purity: 0.99
- Supply Ability: 20tons
- 2-nitromesitylene
-
-
2026-06-30
- CAS:603-71-4
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 10000kg
|
| | 2-NITROMESITYLENE Basic information |
| Product Name: | 2-NITROMESITYLENE | | Synonyms: | NITROMESITYLENE;2-NITRO-1,3,5-TRIMETHYLBENZENE;2-NITROMESITYLENE;3,5-Dimethyl-4-nitrotoluene;1,3,5-trimethyl-2-nitro-benzen;1,3,5-Trimethyl-2-nitro-benzene;1-Nitro-2,4,6-trimethylbenzene;2,4,6-Trimethyl-1-nitrobenzene | | CAS: | 603-71-4 | | MF: | C9H11NO2 | | MW: | 165.19 | | EINECS: | 210-054-9 | | Product Categories: | Aromatic Hydrocarbons (substituted) & Derivatives | | Mol File: | 603-71-4.mol |  |
| | 2-NITROMESITYLENE Chemical Properties |
| Melting point | 41-44 °C(lit.) | | Boiling point | 255 °C(lit.) | | density | 1.1160 (estimate) | | refractive index | 1.5278 (estimate) | | Fp | 187 °F | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow <41°C Solid,>44°C Liquid | | InChI | InChI=1S/C9H11NO2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 | | InChIKey | SCEKDQTVGHRSNS-UHFFFAOYSA-N | | SMILES | C1(C)=CC(C)=CC(C)=C1[N+]([O-])=O | | CAS DataBase Reference | 603-71-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1,3,5-trimethyl-2-nitro- (603-71-4) |
| | 2-NITROMESITYLENE Usage And Synthesis |
| Uses | 2-Nitromesitylene is a substituted nitrobenzene derivative used in medicine and functional healthy food, pharmaceutical compounds comprising substituted nitrobenzene derivatives for prevention and/or treatment of various diseases. | | Purification Methods | Crystallise it from EtOH, or a small volume of MeOH and cool in an ice-salt bath (m 43.5o). [Powell & Johnson Org Synth Coll Vol II 449 1943, Beilstein 5 H 410, 5 III 923, 5 IV 1028.] |
| | 2-NITROMESITYLENE Preparation Products And Raw materials |
|