Lithium Bis(pentafluoroethanesulfonyl)imide manufacturers
|
| | Lithium Bis(pentafluoroethanesulfonyl)imide Basic information |
| Product Name: | Lithium Bis(pentafluoroethanesulfonyl)imide | | Synonyms: | Lithium Bis(pentafluoroethanesulfonyl)imide;Lithium bis(pentafluoroethylsulfonyl)imide;Bis(pentafluoroethanesulfonyl)imide Lithium Salt;LITHIUM BIS(PENTAFLUOROETHANESULFONYL)AMIDE;Lithium bis(perfluoroethylsulfonyl)imide;Lithium Bis[(perfluoroethyl)sulfonyl]amide;Ethanesulfonamide, 1,1,2,2,2-pentafluoro-N-[(1,1,2,2,2-pentafluoroethyl)sulfonyl]-, lithium salt (1:1);LiBETI | | CAS: | 132843-44-8 | | MF: | C4HF10NO4S2.Li | | MW: | 388.11 | | EINECS: | 686-525-1 | | Product Categories: | | | Mol File: | 132843-44-8.mol |  |
| | Lithium Bis(pentafluoroethanesulfonyl)imide Chemical Properties |
| Melting point | 328°C(lit.) | | form | powder to crystal | | color | White to Almost white | | Major Application | battery manufacturing
battery manufacturing | | InChI | InChI=1S/C4F10NO4S2.Li/c5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10;/q-1;+1 | | InChIKey | ACFSQHQYDZIPRL-UHFFFAOYSA-N | | SMILES | [Li+].[N-](S(C(F)(F)C(F)(F)F)(=O)=O)S(C(F)(F)C(F)(F)F)(=O)=O | | CAS DataBase Reference | 132843-44-8 | | EPA Substance Registry System | Ethanesulfonamide, 1,1,2,2,2-pentafluoro-N-[(pentafluoroethyl)sulfonyl]-, lithium salt (132843-44-8) |
| RIDADR | 2923 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HazardClass | 8/6.1 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Lithium Bis(pentafluoroethanesulfonyl)imide Usage And Synthesis |
| Uses | Lithium Bis(pentafluoroethanesulfonyl)imide is a metal elastic anode-protecting layer. |
| | Lithium Bis(pentafluoroethanesulfonyl)imide Preparation Products And Raw materials |
|