|
|
| | 4-Methoxybenzyl bromide Basic information |
| | 4-Methoxybenzyl bromide Chemical Properties |
| Melting point | 240 °C | | Boiling point | 91 °C1 mm Hg(lit.) | | density | 1.379 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5780(lit.) | | Fp | >230 °F | | form | liquid | | color | Faintly hazy, faint yellow | | InChI | InChI=1S/C8H9BrO/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 | | InChIKey | GIGRWGTZFONRKA-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC=C(OC)C=C1 | | CAS DataBase Reference | 2746-25-0(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 1 | | HazardClass | 8 | | HS Code | 29093090 |
| | 4-Methoxybenzyl bromide Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid | | Uses | 4-Methoxybenzyl Bromide is a useful reactant in studying diarylpyrazoles as cyclooxygenase 2 inhibitors. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 55, p. 4469, 1990 DOI: 10.1021/jo00301a051
Synthetic Communications, 6, p. 109, 1976 DOI: 10.1080/00397917608072618 | | Synthesis | McCall et al. reacted 4-methoxybenzyl bromide with resveratrol with hydrogen bromide in n-hexane and toluene in an ice bath to finally obtain 4-methoxybenzyl bromide in 68% yield, this reaction produces by-products. |
| | 4-Methoxybenzyl bromide Preparation Products And Raw materials |
|