- Propargyl-PEG6-PA
-
-
2026-07-24
- CAS:1951438-84-8
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | Propargyl-PEG6-acid Basic information |
| Product Name: | Propargyl-PEG6-acid | | Synonyms: | Propargyl-PEG6-acid;Propyne-PEG5-CH2CH2COOH;Propargyl-PEG5-CH2CH2COOH;CAS_1951438-84-8;4,7,10,13,16,19-Hexaoxadocos-21-ynoic acid;Propargyl-PEG6-Propionic Acid;Propargyl-PEG5-CH2CH2COOH/4,7,10,13,16,19-Hexaoxadocos-21-ynoic acid;Propargyl-PEG5-C2-COOH | | CAS: | 1951438-84-8 | | MF: | C16H28O8 | | MW: | 348.39 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1951438-84-8.mol |  |
| | Propargyl-PEG6-acid Chemical Properties |
| Boiling point | 462.8±45.0 °C(Predicted) | | density | 1.126±0.06 g/cm3(Predicted) | | refractive index | n/D 1.469 | | storage temp. | -20°C | | solubility | Soluble in Water | | form | liquid | | pka | 4.28±0.10(Predicted) | | color | Colorless to light yellow | | InChI | 1S/C16H28O8/c1-2-4-19-6-8-21-10-12-23-14-15-24-13-11-22-9-7-20-5-3-16(17)18/h1H,3-15H2,(H,17,18) | | InChIKey | XRSJYQQOJNYUDV-UHFFFAOYSA-N | | SMILES | OC(CCOCCOCCOCCOCCOCCOCC#C)=O |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | Propargyl-PEG6-acid Usage And Synthesis |
| Description | Propargyl-PEG6-acid comprises propargyl and carboxylic acid functional groups. The acid group reacts with primary amines in the presence of activators (e.g. EDC, or HATU).The propargyl group reacts with azide-bearing compounds or biomolecules via copper catalyzed azide-alkyne Click Chemistry to yield a stable triazole linkage. The molecule has good solubility in aqueous environment. | | Uses | This heterobifunctional, PEGylated crosslinker features a carboxylic acid at one end and propargyl group at the other for reaction with azide-containing compounds using click chemistry. The hydrophillic PEG linker facilitates solubility in biological applications. Propargyl-PEG6-acid can be used for bioconjugation or as a building block for synthesis of small molecules, conjugates of small molecules and/or biomolecules, or other tool compounds for chemical biology and medicinal chemistry that require ligation. Examples of applications include its synthetic incorporation into antibody-drug conjugates or proteolysis-targeting chimeras (PROTAC molecules) for targeted protein degradation. | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent | | IC 50 | Cleavable Linker; PEGs |
| | Propargyl-PEG6-acid Preparation Products And Raw materials |
|