|
|
| | (S)-2-Amino-3-(3-(Methylsulfonyl)Phenyl)Propanoic Acid Basic information |
| Product Name: | (S)-2-Amino-3-(3-(Methylsulfonyl)Phenyl)Propanoic Acid | | Synonyms: | (S)-2-Amino-3-(3-(Methylsulfonyl)Phenyl)Propanoic Acid;L-Phenylalanine, 3-(methylsulfonyl)-;3-(Methylsulfonyl)-L-phenylalanine;(2S)-2-amino-3-(3-methanesulfonylphenyl)propanoic acid;(S)-2-Amino-3-(3-methanesulfonylphenyl) propanoic acid;H-Phe(3-methylsulfonyl)-OH;Li Tasi Special Impurity 23;Lifitegrast Impurity 18(free base) | | CAS: | 1270093-99-6 | | MF: | C10H13NO4S | | MW: | 243.28 | | EINECS: | 815-385-8 | | Product Categories: | | | Mol File: | 1270093-99-6.mol |  |
| | (S)-2-Amino-3-(3-(Methylsulfonyl)Phenyl)Propanoic Acid Chemical Properties |
| Boiling point | 490.1±45.0 °C(Predicted) | | density | 1.357±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 2.14±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H13NO4S/c1-16(14,15)8-4-2-3-7(5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)/t9-/m0/s1 | | InChIKey | QKZNLZTVEVNSPE-VIFPVBQESA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC(S(C)(=O)=O)=C1)N |
| | (S)-2-Amino-3-(3-(Methylsulfonyl)Phenyl)Propanoic Acid Usage And Synthesis |
| | (S)-2-Amino-3-(3-(Methylsulfonyl)Phenyl)Propanoic Acid Preparation Products And Raw materials |
|